").append(n.parseHTML(a)).find(d):a)}).always(c&&function(a,b){g.each(function(){c.apply(this,f||[a.responseText,b,a])})}),this},n.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){n.fn[b]=function(a){return this.on(b,a)}}),n.expr.filters.animated=function(a){return n.grep(n.timers,function(b){return a===b.elem}).length};function lc(a){return n.isWindow(a)?a:9===a.nodeType&&(a.defaultView||a.parentWindow)}n.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=n.css(a,"position"),l=n(a),m={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=n.css(a,"top"),i=n.css(a,"left"),j=("absolute"===k||"fixed"===k)&&n.inArray("auto",[f,i])>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),n.isFunction(b)&&(b=b.call(a,c,n.extend({},h))),null!=b.top&&(m.top=b.top-h.top+g),null!=b.left&&(m.left=b.left-h.left+e),"using"in b?b.using.call(a,m):l.css(m)}},n.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){n.offset.setOffset(this,a,b)});var b,c,d={top:0,left:0},e=this[0],f=e&&e.ownerDocument;if(f)return b=f.documentElement,n.contains(b,e)?(void 0!==e.getBoundingClientRect&&(d=e.getBoundingClientRect()),c=lc(f),{top:d.top+(c.pageYOffset||b.scrollTop)-(b.clientTop||0),left:d.left+(c.pageXOffset||b.scrollLeft)-(b.clientLeft||0)}):d},position:function(){if(this[0]){var a,b,c={top:0,left:0},d=this[0];return"fixed"===n.css(d,"position")?b=d.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),n.nodeName(a[0],"html")||(c=a.offset()),c.top+=n.css(a[0],"borderTopWidth",!0),c.left+=n.css(a[0],"borderLeftWidth",!0)),{top:b.top-c.top-n.css(d,"marginTop",!0),left:b.left-c.left-n.css(d,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var a=this.offsetParent;while(a&&!n.nodeName(a,"html")&&"static"===n.css(a,"position"))a=a.offsetParent;return a||Pa})}}),n.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,b){var c=/Y/.test(b);n.fn[a]=function(d){return X(this,function(a,d,e){var f=lc(a);if(void 0===e)return f?b in f?f[b]:f.document.documentElement[d]:a[d];f?f.scrollTo(c?n(f).scrollLeft():e,c?e:n(f).scrollTop()):a[d]=e},a,d,arguments.length,null)}}),n.each(["top","left"],function(a,b){n.cssHooks[b]=Ta(l.pixelPosition,function(a,c){if(c)return c=Ra(a,b),Na.test(c)?n(a).position()[b]+"px":c})}),n.each({Height:"height",Width:"width"},function(a,b){n.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){n.fn[d]=function(d,e){var f=arguments.length&&(c||"boolean"!=typeof d),g=c||(!0===d||!0===e?"margin":"border") ;return X(this,function(b,c,d){var e;return n.isWindow(b)?b.document.documentElement["client"+a]:9===b.nodeType?(e=b.documentElement,Math.max(b.body["scroll"+a],e["scroll"+a],b.body["offset"+a],e["offset"+a],e["client"+a])):void 0===d?n.css(b,c,g):n.style(b,c,d,g)},b,f?d:void 0,f,null)}})}),n.fn.extend({bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)}}),n.fn.size=function(){return this.length},n.fn.andSelf=n.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return n});var mc=a.jQuery,nc=a.$;return n.noConflict=function(b){return a.$===n&&(a.$=nc),b&&a.jQuery===n&&(a.jQuery=mc),n},b||(a.jQuery=a.$=n),n}); jQuery.noConflict(); // source --> https://czyszczenieimonitoringkanalizacji.pl/wp-content/themes/pure/3rd/bootstrap/js/jquery.mobile.custom.js?ver=5.5.11 /* * jQuery Mobile v1.4.5 * http://jquerymobile.com * * Copyright 2010, 2014 jQuery Foundation, Inc. and other contributors * Released under the MIT license. * http://jquery.org/license * */ (function ( root, doc, factory ) { if ( typeof define === "function" && define.amd ) { // AMD. Register as an anonymous module. define( [ "jquery" ], function ( $ ) { factory( $, root, doc ); return $.mobile; }); } else { // Browser globals factory( root.jQuery, root, doc ); } }( this, document, function ( jQuery, window, document, undefined ) {// This plugin is an experiment for abstracting away the touch and mouse // events so that developers don't have to worry about which method of input // the device their document is loaded on supports. // // The idea here is to allow the developer to register listeners for the // basic mouse events, such as mousedown, mousemove, mouseup, and click, // and the plugin will take care of registering the correct listeners // behind the scenes to invoke the listener at the fastest possible time // for that device, while still retaining the order of event firing in // the traditional mouse environment, should multiple handlers be registered // on the same element for different events. // // The current version exposes the following virtual events to jQuery bind methods: // "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel" (function( $, window, document, undefined ) { var dataPropertyName = "virtualMouseBindings", touchTargetPropertyName = "virtualTouchID", virtualEventNames = "vmouseover vmousedown vmousemove vmouseup vclick vmouseout vmousecancel".split( " " ), touchEventProps = "clientX clientY pageX pageY screenX screenY".split( " " ), mouseHookProps = $.event.mouseHooks ? $.event.mouseHooks.props : [], mouseEventProps = $.event.props.concat( mouseHookProps ), activeDocHandlers = {}, resetTimerID = 0, startX = 0, startY = 0, didScroll = false, clickBlockList = [], blockMouseTriggers = false, blockTouchTriggers = false, eventCaptureSupported = "addEventListener" in document, $document = $( document ), nextTouchID = 1, lastTouchID = 0, threshold, i; $.vmouse = { moveDistanceThreshold: 10, clickDistanceThreshold: 10, resetTimerDuration: 1500 }; function getNativeEvent( event ) { while ( event && typeof event.originalEvent !== "undefined" ) { event = event.originalEvent; } return event; } function createVirtualEvent( event, eventType ) { var t = event.type, oe, props, ne, prop, ct, touch, i, j, len; event = $.Event( event ); event.type = eventType; oe = event.originalEvent; props = $.event.props; // addresses separation of $.event.props in to $.event.mouseHook.props and Issue 3280 // https://github.com/jquery/jquery-mobile/issues/3280 if ( t.search( /^(mouse|click)/ ) > -1 ) { props = mouseEventProps; } // copy original event properties over to the new event // this would happen if we could call $.event.fix instead of $.Event // but we don't have a way to force an event to be fixed multiple times if ( oe ) { for ( i = props.length, prop; i; ) { prop = props[ --i ]; event[ prop ] = oe[ prop ]; } } // make sure that if the mouse and click virtual events are generated // without a .which one is defined if ( t.search(/mouse(down|up)|click/) > -1 && !event.which ) { event.which = 1; } if ( t.search(/^touch/) !== -1 ) { ne = getNativeEvent( oe ); t = ne.touches; ct = ne.changedTouches; touch = ( t && t.length ) ? t[0] : ( ( ct && ct.length ) ? ct[ 0 ] : undefined ); if ( touch ) { for ( j = 0, len = touchEventProps.length; j < len; j++) { prop = touchEventProps[ j ]; event[ prop ] = touch[ prop ]; } } } return event; } function getVirtualBindingFlags( element ) { var flags = {}, b, k; while ( element ) { b = $.data( element, dataPropertyName ); for ( k in b ) { if ( b[ k ] ) { flags[ k ] = flags.hasVirtualBinding = true; } } element = element.parentNode; } return flags; } function getClosestElementWithVirtualBinding( element, eventType ) { var b; while ( element ) { b = $.data( element, dataPropertyName ); if ( b && ( !eventType || b[ eventType ] ) ) { return element; } element = element.parentNode; } return null; } function enableTouchBindings() { blockTouchTriggers = false; } function disableTouchBindings() { blockTouchTriggers = true; } function enableMouseBindings() { lastTouchID = 0; clickBlockList.length = 0; blockMouseTriggers = false; // When mouse bindings are enabled, our // touch bindings are disabled. disableTouchBindings(); } function disableMouseBindings() { // When mouse bindings are disabled, our // touch bindings are enabled. enableTouchBindings(); } function startResetTimer() { clearResetTimer(); resetTimerID = setTimeout( function() { resetTimerID = 0; enableMouseBindings(); }, $.vmouse.resetTimerDuration ); } function clearResetTimer() { if ( resetTimerID ) { clearTimeout( resetTimerID ); resetTimerID = 0; } } function triggerVirtualEvent( eventType, event, flags ) { var ve; if ( ( flags && flags[ eventType ] ) || ( !flags && getClosestElementWithVirtualBinding( event.target, eventType ) ) ) { ve = createVirtualEvent( event, eventType ); $( event.target).trigger( ve ); } return ve; } function mouseEventCallback( event ) { var touchID = $.data( event.target, touchTargetPropertyName ), ve; if ( !blockMouseTriggers && ( !lastTouchID || lastTouchID !== touchID ) ) { ve = triggerVirtualEvent( "v" + event.type, event ); if ( ve ) { if ( ve.isDefaultPrevented() ) { event.preventDefault(); } if ( ve.isPropagationStopped() ) { event.stopPropagation(); } if ( ve.isImmediatePropagationStopped() ) { event.stopImmediatePropagation(); } } } } function handleTouchStart( event ) { var touches = getNativeEvent( event ).touches, target, flags, t; if ( touches && touches.length === 1 ) { target = event.target; flags = getVirtualBindingFlags( target ); if ( flags.hasVirtualBinding ) { lastTouchID = nextTouchID++; $.data( target, touchTargetPropertyName, lastTouchID ); clearResetTimer(); disableMouseBindings(); didScroll = false; t = getNativeEvent( event ).touches[ 0 ]; startX = t.pageX; startY = t.pageY; triggerVirtualEvent( "vmouseover", event, flags ); triggerVirtualEvent( "vmousedown", event, flags ); } } } function handleScroll( event ) { if ( blockTouchTriggers ) { return; } if ( !didScroll ) { triggerVirtualEvent( "vmousecancel", event, getVirtualBindingFlags( event.target ) ); } didScroll = true; startResetTimer(); } function handleTouchMove( event ) { if ( blockTouchTriggers ) { return; } var t = getNativeEvent( event ).touches[ 0 ], didCancel = didScroll, moveThreshold = $.vmouse.moveDistanceThreshold, flags = getVirtualBindingFlags( event.target ); didScroll = didScroll || ( Math.abs( t.pageX - startX ) > moveThreshold || Math.abs( t.pageY - startY ) > moveThreshold ); if ( didScroll && !didCancel ) { triggerVirtualEvent( "vmousecancel", event, flags ); } triggerVirtualEvent( "vmousemove", event, flags ); startResetTimer(); } function handleTouchEnd( event ) { if ( blockTouchTriggers ) { return; } disableTouchBindings(); var flags = getVirtualBindingFlags( event.target ), ve, t; triggerVirtualEvent( "vmouseup", event, flags ); if ( !didScroll ) { ve = triggerVirtualEvent( "vclick", event, flags ); if ( ve && ve.isDefaultPrevented() ) { // The target of the mouse events that follow the touchend // event don't necessarily match the target used during the // touch. This means we need to rely on coordinates for blocking // any click that is generated. t = getNativeEvent( event ).changedTouches[ 0 ]; clickBlockList.push({ touchID: lastTouchID, x: t.clientX, y: t.clientY }); // Prevent any mouse events that follow from triggering // virtual event notifications. blockMouseTriggers = true; } } triggerVirtualEvent( "vmouseout", event, flags); didScroll = false; startResetTimer(); } function hasVirtualBindings( ele ) { var bindings = $.data( ele, dataPropertyName ), k; if ( bindings ) { for ( k in bindings ) { if ( bindings[ k ] ) { return true; } } } return false; } function dummyMouseHandler() {} function getSpecialEventObject( eventType ) { var realType = eventType.substr( 1 ); return { setup: function(/* data, namespace */) { // If this is the first virtual mouse binding for this element, // add a bindings object to its data. if ( !hasVirtualBindings( this ) ) { $.data( this, dataPropertyName, {} ); } // If setup is called, we know it is the first binding for this // eventType, so initialize the count for the eventType to zero. var bindings = $.data( this, dataPropertyName ); bindings[ eventType ] = true; // If this is the first virtual mouse event for this type, // register a global handler on the document. activeDocHandlers[ eventType ] = ( activeDocHandlers[ eventType ] || 0 ) + 1; if ( activeDocHandlers[ eventType ] === 1 ) { $document.bind( realType, mouseEventCallback ); } // Some browsers, like Opera Mini, won't dispatch mouse/click events // for elements unless they actually have handlers registered on them. // To get around this, we register dummy handlers on the elements. $( this ).bind( realType, dummyMouseHandler ); // For now, if event capture is not supported, we rely on mouse handlers. if ( eventCaptureSupported ) { // If this is the first virtual mouse binding for the document, // register our touchstart handler on the document. activeDocHandlers[ "touchstart" ] = ( activeDocHandlers[ "touchstart" ] || 0) + 1; if ( activeDocHandlers[ "touchstart" ] === 1 ) { $document.bind( "touchstart", handleTouchStart ) .bind( "touchend", handleTouchEnd ) // On touch platforms, touching the screen and then dragging your finger // causes the window content to scroll after some distance threshold is // exceeded. On these platforms, a scroll prevents a click event from being // dispatched, and on some platforms, even the touchend is suppressed. To // mimic the suppression of the click event, we need to watch for a scroll // event. Unfortunately, some platforms like iOS don't dispatch scroll // events until *AFTER* the user lifts their finger (touchend). This means // we need to watch both scroll and touchmove events to figure out whether // or not a scroll happenens before the touchend event is fired. .bind( "touchmove", handleTouchMove ) .bind( "scroll", handleScroll ); } } }, teardown: function(/* data, namespace */) { // If this is the last virtual binding for this eventType, // remove its global handler from the document. --activeDocHandlers[ eventType ]; if ( !activeDocHandlers[ eventType ] ) { $document.unbind( realType, mouseEventCallback ); } if ( eventCaptureSupported ) { // If this is the last virtual mouse binding in existence, // remove our document touchstart listener. --activeDocHandlers[ "touchstart" ]; if ( !activeDocHandlers[ "touchstart" ] ) { $document.unbind( "touchstart", handleTouchStart ) .unbind( "touchmove", handleTouchMove ) .unbind( "touchend", handleTouchEnd ) .unbind( "scroll", handleScroll ); } } var $this = $( this ), bindings = $.data( this, dataPropertyName ); // teardown may be called when an element was // removed from the DOM. If this is the case, // jQuery core may have already stripped the element // of any data bindings so we need to check it before // using it. if ( bindings ) { bindings[ eventType ] = false; } // Unregister the dummy event handler. $this.unbind( realType, dummyMouseHandler ); // If this is the last virtual mouse binding on the // element, remove the binding data from the element. if ( !hasVirtualBindings( this ) ) { $this.removeData( dataPropertyName ); } } }; } // Expose our custom events to the jQuery bind/unbind mechanism. for ( i = 0; i < virtualEventNames.length; i++ ) { $.event.special[ virtualEventNames[ i ] ] = getSpecialEventObject( virtualEventNames[ i ] ); } // Add a capture click handler to block clicks. // Note that we require event capture support for this so if the device // doesn't support it, we punt for now and rely solely on mouse events. if ( eventCaptureSupported ) { document.addEventListener( "click", function( e ) { var cnt = clickBlockList.length, target = e.target, x, y, ele, i, o, touchID; if ( cnt ) { x = e.clientX; y = e.clientY; threshold = $.vmouse.clickDistanceThreshold; // The idea here is to run through the clickBlockList to see if // the current click event is in the proximity of one of our // vclick events that had preventDefault() called on it. If we find // one, then we block the click. // // Why do we have to rely on proximity? // // Because the target of the touch event that triggered the vclick // can be different from the target of the click event synthesized // by the browser. The target of a mouse/click event that is synthesized // from a touch event seems to be implementation specific. For example, // some browsers will fire mouse/click events for a link that is near // a touch event, even though the target of the touchstart/touchend event // says the user touched outside the link. Also, it seems that with most // browsers, the target of the mouse/click event is not calculated until the // time it is dispatched, so if you replace an element that you touched // with another element, the target of the mouse/click will be the new // element underneath that point. // // Aside from proximity, we also check to see if the target and any // of its ancestors were the ones that blocked a click. This is necessary // because of the strange mouse/click target calculation done in the // Android 2.1 browser, where if you click on an element, and there is a // mouse/click handler on one of its ancestors, the target will be the // innermost child of the touched element, even if that child is no where // near the point of touch. ele = target; while ( ele ) { for ( i = 0; i < cnt; i++ ) { o = clickBlockList[ i ]; touchID = 0; if ( ( ele === target && Math.abs( o.x - x ) < threshold && Math.abs( o.y - y ) < threshold ) || $.data( ele, touchTargetPropertyName ) === o.touchID ) { // XXX: We may want to consider removing matches from the block list // instead of waiting for the reset timer to fire. e.preventDefault(); e.stopPropagation(); return; } } ele = ele.parentNode; } } }, true); } })( jQuery, window, document ); (function( $ ) { $.mobile = {}; }( jQuery )); (function( $, undefined ) { var support = { touch: "ontouchend" in document }; $.mobile.support = $.mobile.support || {}; $.extend( $.support, support ); $.extend( $.mobile.support, support ); }( jQuery )); (function( $, window, undefined ) { var $document = $( document ), supportTouch = $.mobile.support.touch, scrollEvent = "touchmove scroll", touchStartEvent = supportTouch ? "touchstart" : "mousedown", touchStopEvent = supportTouch ? "touchend" : "mouseup", touchMoveEvent = supportTouch ? "touchmove" : "mousemove"; // setup new event shortcuts $.each( ( "touchstart touchmove touchend " + "tap taphold " + "swipe swipeleft swiperight " + "scrollstart scrollstop" ).split( " " ), function( i, name ) { $.fn[ name ] = function( fn ) { return fn ? this.bind( name, fn ) : this.trigger( name ); }; // jQuery < 1.8 if ( $.attrFn ) { $.attrFn[ name ] = true; } }); function triggerCustomEvent( obj, eventType, event, bubble ) { var originalType = event.type; event.type = eventType; if ( bubble ) { $.event.trigger( event, undefined, obj ); } else { $.event.dispatch.call( obj, event ); } event.type = originalType; } // also handles scrollstop $.event.special.scrollstart = { enabled: true, setup: function() { var thisObject = this, $this = $( thisObject ), scrolling, timer; function trigger( event, state ) { scrolling = state; triggerCustomEvent( thisObject, scrolling ? "scrollstart" : "scrollstop", event ); } // iPhone triggers scroll after a small delay; use touchmove instead $this.bind( scrollEvent, function( event ) { if ( !$.event.special.scrollstart.enabled ) { return; } if ( !scrolling ) { trigger( event, true ); } clearTimeout( timer ); timer = setTimeout( function() { trigger( event, false ); }, 50 ); }); }, teardown: function() { $( this ).unbind( scrollEvent ); } }; // also handles taphold $.event.special.tap = { tapholdThreshold: 750, emitTapOnTaphold: true, setup: function() { var thisObject = this, $this = $( thisObject ), isTaphold = false; $this.bind( "vmousedown", function( event ) { isTaphold = false; if ( event.which && event.which !== 1 ) { return false; } var origTarget = event.target, timer; function clearTapTimer() { clearTimeout( timer ); } function clearTapHandlers() { clearTapTimer(); $this.unbind( "vclick", clickHandler ) .unbind( "vmouseup", clearTapTimer ); $document.unbind( "vmousecancel", clearTapHandlers ); } function clickHandler( event ) { clearTapHandlers(); // ONLY trigger a 'tap' event if the start target is // the same as the stop target. if ( !isTaphold && origTarget === event.target ) { triggerCustomEvent( thisObject, "tap", event ); } else if ( isTaphold ) { event.preventDefault(); } } $this.bind( "vmouseup", clearTapTimer ) .bind( "vclick", clickHandler ); $document.bind( "vmousecancel", clearTapHandlers ); timer = setTimeout( function() { if ( !$.event.special.tap.emitTapOnTaphold ) { isTaphold = true; } triggerCustomEvent( thisObject, "taphold", $.Event( "taphold", { target: origTarget } ) ); }, $.event.special.tap.tapholdThreshold ); }); }, teardown: function() { $( this ).unbind( "vmousedown" ).unbind( "vclick" ).unbind( "vmouseup" ); $document.unbind( "vmousecancel" ); } }; // Also handles swipeleft, swiperight $.event.special.swipe = { // More than this horizontal displacement, and we will suppress scrolling. scrollSupressionThreshold: 30, // More time than this, and it isn't a swipe. durationThreshold: 1000, // Swipe horizontal displacement must be more than this. horizontalDistanceThreshold: 30, // Swipe vertical displacement must be less than this. verticalDistanceThreshold: 30, getLocation: function ( event ) { var winPageX = window.pageXOffset, winPageY = window.pageYOffset, x = event.clientX, y = event.clientY; if ( event.pageY === 0 && Math.floor( y ) > Math.floor( event.pageY ) || event.pageX === 0 && Math.floor( x ) > Math.floor( event.pageX ) ) { // iOS4 clientX/clientY have the value that should have been // in pageX/pageY. While pageX/page/ have the value 0 x = x - winPageX; y = y - winPageY; } else if ( y < ( event.pageY - winPageY) || x < ( event.pageX - winPageX ) ) { // Some Android browsers have totally bogus values for clientX/Y // when scrolling/zooming a page. Detectable since clientX/clientY // should never be smaller than pageX/pageY minus page scroll x = event.pageX - winPageX; y = event.pageY - winPageY; } return { x: x, y: y }; }, start: function( event ) { var data = event.originalEvent.touches ? event.originalEvent.touches[ 0 ] : event, location = $.event.special.swipe.getLocation( data ); return { time: ( new Date() ).getTime(), coords: [ location.x, location.y ], origin: $( event.target ) }; }, stop: function( event ) { var data = event.originalEvent.touches ? event.originalEvent.touches[ 0 ] : event, location = $.event.special.swipe.getLocation( data ); return { time: ( new Date() ).getTime(), coords: [ location.x, location.y ] }; }, handleSwipe: function( start, stop, thisObject, origTarget ) { if ( stop.time - start.time < $.event.special.swipe.durationThreshold && Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.horizontalDistanceThreshold && Math.abs( start.coords[ 1 ] - stop.coords[ 1 ] ) < $.event.special.swipe.verticalDistanceThreshold ) { var direction = start.coords[0] > stop.coords[ 0 ] ? "swipeleft" : "swiperight"; triggerCustomEvent( thisObject, "swipe", $.Event( "swipe", { target: origTarget, swipestart: start, swipestop: stop }), true ); triggerCustomEvent( thisObject, direction,$.Event( direction, { target: origTarget, swipestart: start, swipestop: stop } ), true ); return true; } return false; }, // This serves as a flag to ensure that at most one swipe event event is // in work at any given time eventInProgress: false, setup: function() { var events, thisObject = this, $this = $( thisObject ), context = {}; // Retrieve the events data for this element and add the swipe context events = $.data( this, "mobile-events" ); if ( !events ) { events = { length: 0 }; $.data( this, "mobile-events", events ); } events.length++; events.swipe = context; context.start = function( event ) { // Bail if we're already working on a swipe event if ( $.event.special.swipe.eventInProgress ) { return; } $.event.special.swipe.eventInProgress = true; var stop, start = $.event.special.swipe.start( event ), origTarget = event.target, emitted = false; context.move = function( event ) { if ( !start || event.isDefaultPrevented() ) { return; } stop = $.event.special.swipe.stop( event ); if ( !emitted ) { emitted = $.event.special.swipe.handleSwipe( start, stop, thisObject, origTarget ); if ( emitted ) { // Reset the context to make way for the next swipe event $.event.special.swipe.eventInProgress = false; } } // prevent scrolling if ( Math.abs( start.coords[ 0 ] - stop.coords[ 0 ] ) > $.event.special.swipe.scrollSupressionThreshold ) { event.preventDefault(); } }; context.stop = function() { emitted = true; // Reset the context to make way for the next swipe event $.event.special.swipe.eventInProgress = false; $document.off( touchMoveEvent, context.move ); context.move = null; }; $document.on( touchMoveEvent, context.move ) .one( touchStopEvent, context.stop ); }; $this.on( touchStartEvent, context.start ); }, teardown: function() { var events, context; events = $.data( this, "mobile-events" ); if ( events ) { context = events.swipe; delete events.swipe; events.length--; if ( events.length === 0 ) { $.removeData( this, "mobile-events" ); } } if ( context ) { if ( context.start ) { $( this ).off( touchStartEvent, context.start ); } if ( context.move ) { $document.off( touchMoveEvent, context.move ); } if ( context.stop ) { $document.off( touchStopEvent, context.stop ); } } } }; $.each({ scrollstop: "scrollstart", taphold: "tap", swipeleft: "swipe.left", swiperight: "swipe.right" }, function( event, sourceEvent ) { $.event.special[ event ] = { setup: function() { $( this ).bind( sourceEvent, $.noop ); }, teardown: function() { $( this ).unbind( sourceEvent ); } }; }); })( jQuery, this ); })); // source --> https://czyszczenieimonitoringkanalizacji.pl/wp-content/themes/pure/3rd/bootstrap/js/popper.js?ver=5.5.11 /**! * @fileOverview Kickass library to create and place poppers near their reference elements. * @version 1.14.4 * @license * Copyright (c) 2016 Federico Zivolo and contributors * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in all * copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE * SOFTWARE. */ (function (global, factory) { typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() : typeof define === 'function' && define.amd ? define(factory) : (global.Popper = factory()); }(this, (function () { 'use strict'; var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; var timeoutDuration = 0; for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { timeoutDuration = 1; break; } } function microtaskDebounce(fn) { var called = false; return function () { if (called) { return; } called = true; window.Promise.resolve().then(function () { called = false; fn(); }); }; } function taskDebounce(fn) { var scheduled = false; return function () { if (!scheduled) { scheduled = true; setTimeout(function () { scheduled = false; fn(); }, timeoutDuration); } }; } var supportsMicroTasks = isBrowser && window.Promise; /** * Create a debounced version of a method, that's asynchronously deferred * but called in the minimum time possible. * * @method * @memberof Popper.Utils * @argument {Function} fn * @returns {Function} */ var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce; /** * Check if the given variable is a function * @method * @memberof Popper.Utils * @argument {Any} functionToCheck - variable to check * @returns {Boolean} answer to: is a function? */ function isFunction(functionToCheck) { var getType = {}; return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; } /** * Get CSS computed property of the given element * @method * @memberof Popper.Utils * @argument {Eement} element * @argument {String} property */ function getStyleComputedProperty(element, property) { if (element.nodeType !== 1) { return []; } // NOTE: 1 DOM access here var css = getComputedStyle(element, null); return property ? css[property] : css; } /** * Returns the parentNode or the host of the element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} parent */ function getParentNode(element) { if (element.nodeName === 'HTML') { return element; } return element.parentNode || element.host; } /** * Returns the scrolling parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} scroll parent */ function getScrollParent(element) { // Return body, `getScroll` will take care to get the correct `scrollTop` from it if (!element) { return document.body; } switch (element.nodeName) { case 'HTML': case 'BODY': return element.ownerDocument.body; case '#document': return element.body; } // Firefox want us to check `-x` and `-y` variations as well var _getStyleComputedProp = getStyleComputedProperty(element), overflow = _getStyleComputedProp.overflow, overflowX = _getStyleComputedProp.overflowX, overflowY = _getStyleComputedProp.overflowY; if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { return element; } return getScrollParent(getParentNode(element)); } var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode); var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent); /** * Determines if the browser is Internet Explorer * @method * @memberof Popper.Utils * @param {Number} version to check * @returns {Boolean} isIE */ function isIE(version) { if (version === 11) { return isIE11; } if (version === 10) { return isIE10; } return isIE11 || isIE10; } /** * Returns the offset parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} offset parent */ function getOffsetParent(element) { if (!element) { return document.documentElement; } var noOffsetParent = isIE(10) ? document.body : null; // NOTE: 1 DOM access here var offsetParent = element.offsetParent; // Skip hidden elements which don't have an offsetParent while (offsetParent === noOffsetParent && element.nextElementSibling) { offsetParent = (element = element.nextElementSibling).offsetParent; } var nodeName = offsetParent && offsetParent.nodeName; if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { return element ? element.ownerDocument.documentElement : document.documentElement; } // .offsetParent will return the closest TD or TABLE in case // no offsetParent is present, I hate this job... if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { return getOffsetParent(offsetParent); } return offsetParent; } function isOffsetContainer(element) { var nodeName = element.nodeName; if (nodeName === 'BODY') { return false; } return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; } /** * Finds the root node (document, shadowDOM root) of the given element * @method * @memberof Popper.Utils * @argument {Element} node * @returns {Element} root node */ function getRoot(node) { if (node.parentNode !== null) { return getRoot(node.parentNode); } return node; } /** * Finds the offset parent common to the two provided nodes * @method * @memberof Popper.Utils * @argument {Element} element1 * @argument {Element} element2 * @returns {Element} common offset parent */ function findCommonOffsetParent(element1, element2) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { return document.documentElement; } // Here we make sure to give as "start" the element that comes first in the DOM var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; var start = order ? element1 : element2; var end = order ? element2 : element1; // Get common ancestor container var range = document.createRange(); range.setStart(start, 0); range.setEnd(end, 0); var commonAncestorContainer = range.commonAncestorContainer; // Both nodes are inside #document if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { if (isOffsetContainer(commonAncestorContainer)) { return commonAncestorContainer; } return getOffsetParent(commonAncestorContainer); } // one of the nodes is inside shadowDOM, find which one var element1root = getRoot(element1); if (element1root.host) { return findCommonOffsetParent(element1root.host, element2); } else { return findCommonOffsetParent(element1, getRoot(element2).host); } } /** * Gets the scroll value of the given element in the given side (top and left) * @method * @memberof Popper.Utils * @argument {Element} element * @argument {String} side `top` or `left` * @returns {number} amount of scrolled pixels */ function getScroll(element) { var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { var html = element.ownerDocument.documentElement; var scrollingElement = element.ownerDocument.scrollingElement || html; return scrollingElement[upperSide]; } return element[upperSide]; } /* * Sum or subtract the element scroll values (left and top) from a given rect object * @method * @memberof Popper.Utils * @param {Object} rect - Rect object you want to change * @param {HTMLElement} element - The element from the function reads the scroll values * @param {Boolean} subtract - set to true if you want to subtract the scroll values * @return {Object} rect - The modifier rect object */ function includeScroll(rect, element) { var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); var modifier = subtract ? -1 : 1; rect.top += scrollTop * modifier; rect.bottom += scrollTop * modifier; rect.left += scrollLeft * modifier; rect.right += scrollLeft * modifier; return rect; } /* * Helper to detect borders of a given element * @method * @memberof Popper.Utils * @param {CSSStyleDeclaration} styles * Result of `getStyleComputedProperty` on the given element * @param {String} axis - `x` or `y` * @return {number} borders - The borders size of the given axis */ function getBordersSize(styles, axis) { var sideA = axis === 'x' ? 'Left' : 'Top'; var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); } function getSize(axis, body, html, computedStyle) { return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0); } function getWindowSizes(document) { var body = document.body; var html = document.documentElement; var computedStyle = isIE(10) && getComputedStyle(html); return { height: getSize('Height', body, html, computedStyle), width: getSize('Width', body, html, computedStyle) }; } var classCallCheck = function (instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }; var createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); var defineProperty = function (obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }; var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; /** * Given element offsets, generate an output similar to getBoundingClientRect * @method * @memberof Popper.Utils * @argument {Object} offsets * @returns {Object} ClientRect like output */ function getClientRect(offsets) { return _extends({}, offsets, { right: offsets.left + offsets.width, bottom: offsets.top + offsets.height }); } /** * Get bounding client rect of given element * @method * @memberof Popper.Utils * @param {HTMLElement} element * @return {Object} client rect */ function getBoundingClientRect(element) { var rect = {}; // IE10 10 FIX: Please, don't ask, the element isn't // considered in DOM in some circumstances... // This isn't reproducible in IE10 compatibility mode of IE11 try { if (isIE(10)) { rect = element.getBoundingClientRect(); var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); rect.top += scrollTop; rect.left += scrollLeft; rect.bottom += scrollTop; rect.right += scrollLeft; } else { rect = element.getBoundingClientRect(); } } catch (e) {} var result = { left: rect.left, top: rect.top, width: rect.right - rect.left, height: rect.bottom - rect.top }; // subtract scrollbar size from sizes var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {}; var width = sizes.width || element.clientWidth || result.right - result.left; var height = sizes.height || element.clientHeight || result.bottom - result.top; var horizScrollbar = element.offsetWidth - width; var vertScrollbar = element.offsetHeight - height; // if an hypothetical scrollbar is detected, we must be sure it's not a `border` // we make this check conditional for performance reasons if (horizScrollbar || vertScrollbar) { var styles = getStyleComputedProperty(element); horizScrollbar -= getBordersSize(styles, 'x'); vertScrollbar -= getBordersSize(styles, 'y'); result.width -= horizScrollbar; result.height -= vertScrollbar; } return getClientRect(result); } function getOffsetRectRelativeToArbitraryNode(children, parent) { var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var isIE10 = isIE(10); var isHTML = parent.nodeName === 'HTML'; var childrenRect = getBoundingClientRect(children); var parentRect = getBoundingClientRect(parent); var scrollParent = getScrollParent(children); var styles = getStyleComputedProperty(parent); var borderTopWidth = parseFloat(styles.borderTopWidth, 10); var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); // In cases where the parent is fixed, we must ignore negative scroll in offset calc if (fixedPosition && isHTML) { parentRect.top = Math.max(parentRect.top, 0); parentRect.left = Math.max(parentRect.left, 0); } var offsets = getClientRect({ top: childrenRect.top - parentRect.top - borderTopWidth, left: childrenRect.left - parentRect.left - borderLeftWidth, width: childrenRect.width, height: childrenRect.height }); offsets.marginTop = 0; offsets.marginLeft = 0; // Subtract margins of documentElement in case it's being used as parent // we do this only on HTML because it's the only element that behaves // differently when margins are applied to it. The margins are included in // the box of the documentElement, in the other cases not. if (!isIE10 && isHTML) { var marginTop = parseFloat(styles.marginTop, 10); var marginLeft = parseFloat(styles.marginLeft, 10); offsets.top -= borderTopWidth - marginTop; offsets.bottom -= borderTopWidth - marginTop; offsets.left -= borderLeftWidth - marginLeft; offsets.right -= borderLeftWidth - marginLeft; // Attach marginTop and marginLeft because in some circumstances we may need them offsets.marginTop = marginTop; offsets.marginLeft = marginLeft; } if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { offsets = includeScroll(offsets, parent); } return offsets; } function getViewportOffsetRectRelativeToArtbitraryNode(element) { var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var html = element.ownerDocument.documentElement; var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); var width = Math.max(html.clientWidth, window.innerWidth || 0); var height = Math.max(html.clientHeight, window.innerHeight || 0); var scrollTop = !excludeScroll ? getScroll(html) : 0; var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; var offset = { top: scrollTop - relativeOffset.top + relativeOffset.marginTop, left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, width: width, height: height }; return getClientRect(offset); } /** * Check if the given element is fixed or is inside a fixed parent * @method * @memberof Popper.Utils * @argument {Element} element * @argument {Element} customContainer * @returns {Boolean} answer to "isFixed?" */ function isFixed(element) { var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { return false; } if (getStyleComputedProperty(element, 'position') === 'fixed') { return true; } return isFixed(getParentNode(element)); } /** * Finds the first parent of an element that has a transformed property defined * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} first transformed parent or documentElement */ function getFixedPositionOffsetParent(element) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element || !element.parentElement || isIE()) { return document.documentElement; } var el = element.parentElement; while (el && getStyleComputedProperty(el, 'transform') === 'none') { el = el.parentElement; } return el || document.documentElement; } /** * Computed the boundaries limits and return them * @method * @memberof Popper.Utils * @param {HTMLElement} popper * @param {HTMLElement} reference * @param {number} padding * @param {HTMLElement} boundariesElement - Element used to define the boundaries * @param {Boolean} fixedPosition - Is in fixed position mode * @returns {Object} Coordinates of the boundaries */ function getBoundaries(popper, reference, padding, boundariesElement) { var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; // NOTE: 1 DOM access here var boundaries = { top: 0, left: 0 }; var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); // Handle viewport case if (boundariesElement === 'viewport') { boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); } else { // Handle other cases based on DOM element used as boundaries var boundariesNode = void 0; if (boundariesElement === 'scrollParent') { boundariesNode = getScrollParent(getParentNode(reference)); if (boundariesNode.nodeName === 'BODY') { boundariesNode = popper.ownerDocument.documentElement; } } else if (boundariesElement === 'window') { boundariesNode = popper.ownerDocument.documentElement; } else { boundariesNode = boundariesElement; } var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); // In case of HTML, we need a different computation if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { var _getWindowSizes = getWindowSizes(popper.ownerDocument), height = _getWindowSizes.height, width = _getWindowSizes.width; boundaries.top += offsets.top - offsets.marginTop; boundaries.bottom = height + offsets.top; boundaries.left += offsets.left - offsets.marginLeft; boundaries.right = width + offsets.left; } else { // for all the other DOM elements, this one is good boundaries = offsets; } } // Add paddings padding = padding || 0; var isPaddingNumber = typeof padding === 'number'; boundaries.left += isPaddingNumber ? padding : padding.left || 0; boundaries.top += isPaddingNumber ? padding : padding.top || 0; boundaries.right -= isPaddingNumber ? padding : padding.right || 0; boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0; return boundaries; } function getArea(_ref) { var width = _ref.width, height = _ref.height; return width * height; } /** * Utility used to transform the `auto` placement to the placement with more * available space. * @method * @memberof Popper.Utils * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; if (placement.indexOf('auto') === -1) { return placement; } var boundaries = getBoundaries(popper, reference, padding, boundariesElement); var rects = { top: { width: boundaries.width, height: refRect.top - boundaries.top }, right: { width: boundaries.right - refRect.right, height: boundaries.height }, bottom: { width: boundaries.width, height: boundaries.bottom - refRect.bottom }, left: { width: refRect.left - boundaries.left, height: boundaries.height } }; var sortedAreas = Object.keys(rects).map(function (key) { return _extends({ key: key }, rects[key], { area: getArea(rects[key]) }); }).sort(function (a, b) { return b.area - a.area; }); var filteredAreas = sortedAreas.filter(function (_ref2) { var width = _ref2.width, height = _ref2.height; return width >= popper.clientWidth && height >= popper.clientHeight; }); var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; var variation = placement.split('-')[1]; return computedPlacement + (variation ? '-' + variation : ''); } /** * Get offsets to the reference element * @method * @memberof Popper.Utils * @param {Object} state * @param {Element} popper - the popper element * @param {Element} reference - the reference element (the popper will be relative to this) * @param {Element} fixedPosition - is in fixed position mode * @returns {Object} An object containing the offsets which will be applied to the popper */ function getReferenceOffsets(state, popper, reference) { var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, reference); return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); } /** * Get the outer sizes of the given element (offset size + margins) * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Object} object containing width and height properties */ function getOuterSizes(element) { var styles = getComputedStyle(element); var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom); var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight); var result = { width: element.offsetWidth + y, height: element.offsetHeight + x }; return result; } /** * Get the opposite placement of the given one * @method * @memberof Popper.Utils * @argument {String} placement * @returns {String} flipped placement */ function getOppositePlacement(placement) { var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; return placement.replace(/left|right|bottom|top/g, function (matched) { return hash[matched]; }); } /** * Get offsets to the popper * @method * @memberof Popper.Utils * @param {Object} position - CSS position the Popper will get applied * @param {HTMLElement} popper - the popper element * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) * @param {String} placement - one of the valid placement options * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper */ function getPopperOffsets(popper, referenceOffsets, placement) { placement = placement.split('-')[0]; // Get popper node sizes var popperRect = getOuterSizes(popper); // Add position, width and height to our offsets object var popperOffsets = { width: popperRect.width, height: popperRect.height }; // depending by the popper placement we have to compute its offsets slightly differently var isHoriz = ['right', 'left'].indexOf(placement) !== -1; var mainSide = isHoriz ? 'top' : 'left'; var secondarySide = isHoriz ? 'left' : 'top'; var measurement = isHoriz ? 'height' : 'width'; var secondaryMeasurement = !isHoriz ? 'height' : 'width'; popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; if (placement === secondarySide) { popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; } else { popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; } return popperOffsets; } /** * Mimics the `find` method of Array * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function find(arr, check) { // use native find if supported if (Array.prototype.find) { return arr.find(check); } // use `filter` to obtain the same behavior of `find` return arr.filter(check)[0]; } /** * Return the index of the matching object * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function findIndex(arr, prop, value) { // use native findIndex if supported if (Array.prototype.findIndex) { return arr.findIndex(function (cur) { return cur[prop] === value; }); } // use `find` + `indexOf` if `findIndex` isn't supported var match = find(arr, function (obj) { return obj[prop] === value; }); return arr.indexOf(match); } /** * Loop trough the list of modifiers and run them in order, * each of them will then edit the data object. * @method * @memberof Popper.Utils * @param {dataObject} data * @param {Array} modifiers * @param {String} ends - Optional modifier name used as stopper * @returns {dataObject} */ function runModifiers(modifiers, data, ends) { var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); modifiersToRun.forEach(function (modifier) { if (modifier['function']) { // eslint-disable-line dot-notation console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); } var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation if (modifier.enabled && isFunction(fn)) { // Add properties to offsets to make them a complete clientRect object // we do this before each modifier to make sure the previous one doesn't // mess with these values data.offsets.popper = getClientRect(data.offsets.popper); data.offsets.reference = getClientRect(data.offsets.reference); data = fn(data, modifier); } }); return data; } /** * Updates the position of the popper, computing the new offsets and applying * the new style.
* Prefer `scheduleUpdate` over `update` because of performance reasons. * @method * @memberof Popper */ function update() { // if popper is destroyed, don't perform any further update if (this.state.isDestroyed) { return; } var data = { instance: this, styles: {}, arrowStyles: {}, attributes: {}, flipped: false, offsets: {} }; // compute reference element offsets data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); // store the computed placement inside `originalPlacement` data.originalPlacement = data.placement; data.positionFixed = this.options.positionFixed; // compute the popper offsets data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; // run the modifiers data = runModifiers(this.modifiers, data); // the first `update` will call `onCreate` callback // the other ones will call `onUpdate` callback if (!this.state.isCreated) { this.state.isCreated = true; this.options.onCreate(data); } else { this.options.onUpdate(data); } } /** * Helper used to know if the given modifier is enabled. * @method * @memberof Popper.Utils * @returns {Boolean} */ function isModifierEnabled(modifiers, modifierName) { return modifiers.some(function (_ref) { var name = _ref.name, enabled = _ref.enabled; return enabled && name === modifierName; }); } /** * Get the prefixed supported property name * @method * @memberof Popper.Utils * @argument {String} property (camelCase) * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) */ function getSupportedPropertyName(property) { var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; var upperProp = property.charAt(0).toUpperCase() + property.slice(1); for (var i = 0; i < prefixes.length; i++) { var prefix = prefixes[i]; var toCheck = prefix ? '' + prefix + upperProp : property; if (typeof document.body.style[toCheck] !== 'undefined') { return toCheck; } } return null; } /** * Destroys the popper. * @method * @memberof Popper */ function destroy() { this.state.isDestroyed = true; // touch DOM only if `applyStyle` modifier is enabled if (isModifierEnabled(this.modifiers, 'applyStyle')) { this.popper.removeAttribute('x-placement'); this.popper.style.position = ''; this.popper.style.top = ''; this.popper.style.left = ''; this.popper.style.right = ''; this.popper.style.bottom = ''; this.popper.style.willChange = ''; this.popper.style[getSupportedPropertyName('transform')] = ''; } this.disableEventListeners(); // remove the popper if user explicity asked for the deletion on destroy // do not use `remove` because IE11 doesn't support it if (this.options.removeOnDestroy) { this.popper.parentNode.removeChild(this.popper); } return this; } /** * Get the window associated with the element * @argument {Element} element * @returns {Window} */ function getWindow(element) { var ownerDocument = element.ownerDocument; return ownerDocument ? ownerDocument.defaultView : window; } function attachToScrollParents(scrollParent, event, callback, scrollParents) { var isBody = scrollParent.nodeName === 'BODY'; var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; target.addEventListener(event, callback, { passive: true }); if (!isBody) { attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); } scrollParents.push(target); } /** * Setup needed event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function setupEventListeners(reference, options, state, updateBound) { // Resize event listener on window state.updateBound = updateBound; getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); // Scroll event listener on scroll parents var scrollElement = getScrollParent(reference); attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); state.scrollElement = scrollElement; state.eventsEnabled = true; return state; } /** * It will add resize/scroll events and start recalculating * position of the popper element when they are triggered. * @method * @memberof Popper */ function enableEventListeners() { if (!this.state.eventsEnabled) { this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); } } /** * Remove event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function removeEventListeners(reference, state) { // Remove resize event listener on window getWindow(reference).removeEventListener('resize', state.updateBound); // Remove scroll event listener on scroll parents state.scrollParents.forEach(function (target) { target.removeEventListener('scroll', state.updateBound); }); // Reset state state.updateBound = null; state.scrollParents = []; state.scrollElement = null; state.eventsEnabled = false; return state; } /** * It will remove resize/scroll events and won't recalculate popper position * when they are triggered. It also won't trigger `onUpdate` callback anymore, * unless you call `update` method manually. * @method * @memberof Popper */ function disableEventListeners() { if (this.state.eventsEnabled) { cancelAnimationFrame(this.scheduleUpdate); this.state = removeEventListeners(this.reference, this.state); } } /** * Tells if a given input is a number * @method * @memberof Popper.Utils * @param {*} input to check * @return {Boolean} */ function isNumeric(n) { return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); } /** * Set the style to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the style to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setStyles(element, styles) { Object.keys(styles).forEach(function (prop) { var unit = ''; // add unit if the value is numeric and is one of the following if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { unit = 'px'; } element.style[prop] = styles[prop] + unit; }); } /** * Set the attributes to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the attributes to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setAttributes(element, attributes) { Object.keys(attributes).forEach(function (prop) { var value = attributes[prop]; if (value !== false) { element.setAttribute(prop, attributes[prop]); } else { element.removeAttribute(prop); } }); } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} data.styles - List of style properties - values to apply to popper element * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element * @argument {Object} options - Modifiers configuration and options * @returns {Object} The same data object */ function applyStyle(data) { // any property present in `data.styles` will be applied to the popper, // in this way we can make the 3rd party modifiers add custom styles to it // Be aware, modifiers could override the properties defined in the previous // lines of this modifier! setStyles(data.instance.popper, data.styles); // any property present in `data.attributes` will be applied to the popper, // they will be set as HTML attributes of the element setAttributes(data.instance.popper, data.attributes); // if arrowElement is defined and arrowStyles has some properties if (data.arrowElement && Object.keys(data.arrowStyles).length) { setStyles(data.arrowElement, data.arrowStyles); } return data; } /** * Set the x-placement attribute before everything else because it could be used * to add margins to the popper margins needs to be calculated to get the * correct popper offsets. * @method * @memberof Popper.modifiers * @param {HTMLElement} reference - The reference element used to position the popper * @param {HTMLElement} popper - The HTML element used as popper * @param {Object} options - Popper.js options */ function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { // compute reference element offsets var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); popper.setAttribute('x-placement', placement); // Apply `position` to popper before anything else because // without the position applied we can't guarantee correct computations setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); return options; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeStyle(data, options) { var x = options.x, y = options.y; var popper = data.offsets.popper; // Remove this legacy support in Popper.js v2 var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { return modifier.name === 'applyStyle'; }).gpuAcceleration; if (legacyGpuAccelerationOption !== undefined) { console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); } var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; var offsetParent = getOffsetParent(data.instance.popper); var offsetParentRect = getBoundingClientRect(offsetParent); // Styles var styles = { position: popper.position }; // Avoid blurry text by using full pixel integers. // For pixel-perfect positioning, top/bottom prefers rounded // values, while left/right prefers floored values. var offsets = { left: Math.floor(popper.left), top: Math.round(popper.top), bottom: Math.round(popper.bottom), right: Math.floor(popper.right) }; var sideA = x === 'bottom' ? 'top' : 'bottom'; var sideB = y === 'right' ? 'left' : 'right'; // if gpuAcceleration is set to `true` and transform is supported, // we use `translate3d` to apply the position to the popper we // automatically use the supported prefixed version if needed var prefixedProperty = getSupportedPropertyName('transform'); // now, let's make a step back and look at this code closely (wtf?) // If the content of the popper grows once it's been positioned, it // may happen that the popper gets misplaced because of the new content // overflowing its reference element // To avoid this problem, we provide two options (x and y), which allow // the consumer to define the offset origin. // If we position a popper on top of a reference element, we can set // `x` to `top` to make the popper grow towards its top instead of // its bottom. var left = void 0, top = void 0; if (sideA === 'bottom') { // when offsetParent is the positioning is relative to the bottom of the screen (excluding the scrollbar) // and not the bottom of the html element if (offsetParent.nodeName === 'HTML') { top = -offsetParent.clientHeight + offsets.bottom; } else { top = -offsetParentRect.height + offsets.bottom; } } else { top = offsets.top; } if (sideB === 'right') { if (offsetParent.nodeName === 'HTML') { left = -offsetParent.clientWidth + offsets.right; } else { left = -offsetParentRect.width + offsets.right; } } else { left = offsets.left; } if (gpuAcceleration && prefixedProperty) { styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; styles[sideA] = 0; styles[sideB] = 0; styles.willChange = 'transform'; } else { // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties var invertTop = sideA === 'bottom' ? -1 : 1; var invertLeft = sideB === 'right' ? -1 : 1; styles[sideA] = top * invertTop; styles[sideB] = left * invertLeft; styles.willChange = sideA + ', ' + sideB; } // Attributes var attributes = { 'x-placement': data.placement }; // Update `data` attributes, styles and arrowStyles data.attributes = _extends({}, attributes, data.attributes); data.styles = _extends({}, styles, data.styles); data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles); return data; } /** * Helper used to know if the given modifier depends from another one.
* It checks if the needed modifier is listed and enabled. * @method * @memberof Popper.Utils * @param {Array} modifiers - list of modifiers * @param {String} requestingName - name of requesting modifier * @param {String} requestedName - name of requested modifier * @returns {Boolean} */ function isModifierRequired(modifiers, requestingName, requestedName) { var requesting = find(modifiers, function (_ref) { var name = _ref.name; return name === requestingName; }); var isRequired = !!requesting && modifiers.some(function (modifier) { return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; }); if (!isRequired) { var _requesting = '`' + requestingName + '`'; var requested = '`' + requestedName + '`'; console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); } return isRequired; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function arrow(data, options) { var _data$offsets$arrow; // arrow depends on keepTogether in order to work if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { return data; } var arrowElement = options.element; // if arrowElement is a string, suppose it's a CSS selector if (typeof arrowElement === 'string') { arrowElement = data.instance.popper.querySelector(arrowElement); // if arrowElement is not found, don't run the modifier if (!arrowElement) { return data; } } else { // if the arrowElement isn't a query selector we must check that the // provided DOM node is child of its popper node if (!data.instance.popper.contains(arrowElement)) { console.warn('WARNING: `arrow.element` must be child of its popper element!'); return data; } } var placement = data.placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isVertical = ['left', 'right'].indexOf(placement) !== -1; var len = isVertical ? 'height' : 'width'; var sideCapitalized = isVertical ? 'Top' : 'Left'; var side = sideCapitalized.toLowerCase(); var altSide = isVertical ? 'left' : 'top'; var opSide = isVertical ? 'bottom' : 'right'; var arrowElementSize = getOuterSizes(arrowElement)[len]; // // extends keepTogether behavior making sure the popper and its // reference have enough pixels in conjunction // // top/left side if (reference[opSide] - arrowElementSize < popper[side]) { data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); } // bottom/right side if (reference[side] + arrowElementSize > popper[opSide]) { data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; } data.offsets.popper = getClientRect(data.offsets.popper); // compute center of the popper var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; // Compute the sideValue using the updated popper offsets // take popper margin in account because we don't have this info available var css = getStyleComputedProperty(data.instance.popper); var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; // prevent arrowElement from being placed not contiguously to its popper sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); data.arrowElement = arrowElement; data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); return data; } /** * Get the opposite placement variation of the given one * @method * @memberof Popper.Utils * @argument {String} placement variation * @returns {String} flipped placement variation */ function getOppositeVariation(variation) { if (variation === 'end') { return 'start'; } else if (variation === 'start') { return 'end'; } return variation; } /** * List of accepted placements to use as values of the `placement` option.
* Valid placements are: * - `auto` * - `top` * - `right` * - `bottom` * - `left` * * Each placement can have a variation from this list: * - `-start` * - `-end` * * Variations are interpreted easily if you think of them as the left to right * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` * is right.
* Vertically (`left` and `right`), `start` is top and `end` is bottom. * * Some valid examples are: * - `top-end` (on top of reference, right aligned) * - `right-start` (on right of reference, top aligned) * - `bottom` (on bottom, centered) * - `auto-end` (on the side with more space available, alignment depends by placement) * * @static * @type {Array} * @enum {String} * @readonly * @method placements * @memberof Popper */ var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; // Get rid of `auto` `auto-start` and `auto-end` var validPlacements = placements.slice(3); /** * Given an initial placement, returns all the subsequent placements * clockwise (or counter-clockwise). * * @method * @memberof Popper.Utils * @argument {String} placement - A valid placement (it accepts variations) * @argument {Boolean} counter - Set to true to walk the placements counterclockwise * @returns {Array} placements including their variations */ function clockwise(placement) { var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var index = validPlacements.indexOf(placement); var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); return counter ? arr.reverse() : arr; } var BEHAVIORS = { FLIP: 'flip', CLOCKWISE: 'clockwise', COUNTERCLOCKWISE: 'counterclockwise' }; /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function flip(data, options) { // if `inner` modifier is enabled, we can't use the `flip` modifier if (isModifierEnabled(data.instance.modifiers, 'inner')) { return data; } if (data.flipped && data.placement === data.originalPlacement) { // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides return data; } var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); var placement = data.placement.split('-')[0]; var placementOpposite = getOppositePlacement(placement); var variation = data.placement.split('-')[1] || ''; var flipOrder = []; switch (options.behavior) { case BEHAVIORS.FLIP: flipOrder = [placement, placementOpposite]; break; case BEHAVIORS.CLOCKWISE: flipOrder = clockwise(placement); break; case BEHAVIORS.COUNTERCLOCKWISE: flipOrder = clockwise(placement, true); break; default: flipOrder = options.behavior; } flipOrder.forEach(function (step, index) { if (placement !== step || flipOrder.length === index + 1) { return data; } placement = data.placement.split('-')[0]; placementOpposite = getOppositePlacement(placement); var popperOffsets = data.offsets.popper; var refOffsets = data.offsets.reference; // using floor because the reference offsets may contain decimals we are not going to consider here var floor = Math.floor; var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; // flip the variation if required var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); if (overlapsRef || overflowsBoundaries || flippedVariation) { // this boolean to detect any flip loop data.flipped = true; if (overlapsRef || overflowsBoundaries) { placement = flipOrder[index + 1]; } if (flippedVariation) { variation = getOppositeVariation(variation); } data.placement = placement + (variation ? '-' + variation : ''); // this object contains `position`, we want to preserve it along with // any additional property we may add in the future data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); data = runModifiers(data.instance.modifiers, data, 'flip'); } }); return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function keepTogether(data) { var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var placement = data.placement.split('-')[0]; var floor = Math.floor; var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; var side = isVertical ? 'right' : 'bottom'; var opSide = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; if (popper[side] < floor(reference[opSide])) { data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; } if (popper[opSide] > floor(reference[side])) { data.offsets.popper[opSide] = floor(reference[side]); } return data; } /** * Converts a string containing value + unit into a px value number * @function * @memberof {modifiers~offset} * @private * @argument {String} str - Value + unit string * @argument {String} measurement - `height` or `width` * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @returns {Number|String} * Value in pixels, or original string if no values were extracted */ function toValue(str, measurement, popperOffsets, referenceOffsets) { // separate value from unit var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); var value = +split[1]; var unit = split[2]; // If it's not a number it's an operator, I guess if (!value) { return str; } if (unit.indexOf('%') === 0) { var element = void 0; switch (unit) { case '%p': element = popperOffsets; break; case '%': case '%r': default: element = referenceOffsets; } var rect = getClientRect(element); return rect[measurement] / 100 * value; } else if (unit === 'vh' || unit === 'vw') { // if is a vh or vw, we calculate the size based on the viewport var size = void 0; if (unit === 'vh') { size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); } else { size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); } return size / 100 * value; } else { // if is an explicit pixel unit, we get rid of the unit and keep the value // if is an implicit unit, it's px, and we return just the value return value; } } /** * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. * @function * @memberof {modifiers~offset} * @private * @argument {String} offset * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @argument {String} basePlacement * @returns {Array} a two cells array with x and y offsets in numbers */ function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { var offsets = [0, 0]; // Use height if placement is left or right and index is 0 otherwise use width // in this way the first offset will use an axis and the second one // will use the other one var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; // Split the offset string to obtain a list of values and operands // The regex addresses values with the plus or minus sign in front (+10, -20, etc) var fragments = offset.split(/(\+|\-)/).map(function (frag) { return frag.trim(); }); // Detect if the offset string contains a pair of values or a single one // they could be separated by comma or space var divider = fragments.indexOf(find(fragments, function (frag) { return frag.search(/,|\s/) !== -1; })); if (fragments[divider] && fragments[divider].indexOf(',') === -1) { console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); } // If divider is found, we divide the list of values and operands to divide // them by ofset X and Y. var splitRegex = /\s*,\s*|\s+/; var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; // Convert the values with units to absolute pixels to allow our computations ops = ops.map(function (op, index) { // Most of the units rely on the orientation of the popper var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; var mergeWithPrevious = false; return op // This aggregates any `+` or `-` sign that aren't considered operators // e.g.: 10 + +5 => [10, +, +5] .reduce(function (a, b) { if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { a[a.length - 1] = b; mergeWithPrevious = true; return a; } else if (mergeWithPrevious) { a[a.length - 1] += b; mergeWithPrevious = false; return a; } else { return a.concat(b); } }, []) // Here we convert the string values into number values (in px) .map(function (str) { return toValue(str, measurement, popperOffsets, referenceOffsets); }); }); // Loop trough the offsets arrays and execute the operations ops.forEach(function (op, index) { op.forEach(function (frag, index2) { if (isNumeric(frag)) { offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); } }); }); return offsets; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @argument {Number|String} options.offset=0 * The offset value as described in the modifier description * @returns {Object} The data object, properly modified */ function offset(data, _ref) { var offset = _ref.offset; var placement = data.placement, _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var basePlacement = placement.split('-')[0]; var offsets = void 0; if (isNumeric(+offset)) { offsets = [+offset, 0]; } else { offsets = parseOffset(offset, popper, reference, basePlacement); } if (basePlacement === 'left') { popper.top += offsets[0]; popper.left -= offsets[1]; } else if (basePlacement === 'right') { popper.top += offsets[0]; popper.left += offsets[1]; } else if (basePlacement === 'top') { popper.left += offsets[0]; popper.top -= offsets[1]; } else if (basePlacement === 'bottom') { popper.left += offsets[0]; popper.top += offsets[1]; } data.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function preventOverflow(data, options) { var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); // If offsetParent is the reference element, we really want to // go one step up and use the next offsetParent as reference to // avoid to make this modifier completely useless and look like broken if (data.instance.reference === boundariesElement) { boundariesElement = getOffsetParent(boundariesElement); } // NOTE: DOM access here // resets the popper's position so that the document size can be calculated excluding // the size of the popper element itself var transformProp = getSupportedPropertyName('transform'); var popperStyles = data.instance.popper.style; // assignment to help minification var top = popperStyles.top, left = popperStyles.left, transform = popperStyles[transformProp]; popperStyles.top = ''; popperStyles.left = ''; popperStyles[transformProp] = ''; var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); // NOTE: DOM access here // restores the original style properties after the offsets have been computed popperStyles.top = top; popperStyles.left = left; popperStyles[transformProp] = transform; options.boundaries = boundaries; var order = options.priority; var popper = data.offsets.popper; var check = { primary: function primary(placement) { var value = popper[placement]; if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { value = Math.max(popper[placement], boundaries[placement]); } return defineProperty({}, placement, value); }, secondary: function secondary(placement) { var mainSide = placement === 'right' ? 'left' : 'top'; var value = popper[mainSide]; if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); } return defineProperty({}, mainSide, value); } }; order.forEach(function (placement) { var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; popper = _extends({}, popper, check[side](placement)); }); data.offsets.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function shift(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var shiftvariation = placement.split('-')[1]; // if shift shiftvariation is specified, run the modifier if (shiftvariation) { var _data$offsets = data.offsets, reference = _data$offsets.reference, popper = _data$offsets.popper; var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; var side = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; var shiftOffsets = { start: defineProperty({}, side, reference[side]), end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement]) }; data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]); } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function hide(data) { if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { return data; } var refRect = data.offsets.reference; var bound = find(data.instance.modifiers, function (modifier) { return modifier.name === 'preventOverflow'; }).boundaries; if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === true) { return data; } data.hide = true; data.attributes['x-out-of-boundaries'] = ''; } else { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === false) { return data; } data.hide = false; data.attributes['x-out-of-boundaries'] = false; } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function inner(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); data.placement = getOppositePlacement(placement); data.offsets.popper = getClientRect(popper); return data; } /** * Modifier function, each modifier can have a function of this type assigned * to its `fn` property.
* These functions will be called on each update, this means that you must * make sure they are performant enough to avoid performance bottlenecks. * * @function ModifierFn * @argument {dataObject} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {dataObject} The data object, properly modified */ /** * Modifiers are plugins used to alter the behavior of your poppers.
* Popper.js uses a set of 9 modifiers to provide all the basic functionalities * needed by the library. * * Usually you don't want to override the `order`, `fn` and `onLoad` props. * All the other properties are configurations that could be tweaked. * @namespace modifiers */ var modifiers = { /** * Modifier used to shift the popper on the start or end of its reference * element.
* It will read the variation of the `placement` property.
* It can be one either `-end` or `-start`. * @memberof modifiers * @inner */ shift: { /** @prop {number} order=100 - Index used to define the order of execution */ order: 100, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: shift }, /** * The `offset` modifier can shift your popper on both its axis. * * It accepts the following units: * - `px` or unit-less, interpreted as pixels * - `%` or `%r`, percentage relative to the length of the reference element * - `%p`, percentage relative to the length of the popper element * - `vw`, CSS viewport width unit * - `vh`, CSS viewport height unit * * For length is intended the main axis relative to the placement of the popper.
* This means that if the placement is `top` or `bottom`, the length will be the * `width`. In case of `left` or `right`, it will be the `height`. * * You can provide a single value (as `Number` or `String`), or a pair of values * as `String` divided by a comma or one (or more) white spaces.
* The latter is a deprecated method because it leads to confusion and will be * removed in v2.
* Additionally, it accepts additions and subtractions between different units. * Note that multiplications and divisions aren't supported. * * Valid examples are: * ``` * 10 * '10%' * '10, 10' * '10%, 10' * '10 + 10%' * '10 - 5vh + 3%' * '-10px + 5vh, 5px - 6%' * ``` * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap * > with their reference element, unfortunately, you will have to disable the `flip` modifier. * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373). * * @memberof modifiers * @inner */ offset: { /** @prop {number} order=200 - Index used to define the order of execution */ order: 200, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: offset, /** @prop {Number|String} offset=0 * The offset value as described in the modifier description */ offset: 0 }, /** * Modifier used to prevent the popper from being positioned outside the boundary. * * A scenario exists where the reference itself is not within the boundaries.
* We can say it has "escaped the boundaries" — or just "escaped".
* In this case we need to decide whether the popper should either: * * - detach from the reference and remain "trapped" in the boundaries, or * - if it should ignore the boundary and "escape with its reference" * * When `escapeWithReference` is set to`true` and reference is completely * outside its boundaries, the popper will overflow (or completely leave) * the boundaries in order to remain attached to the edge of the reference. * * @memberof modifiers * @inner */ preventOverflow: { /** @prop {number} order=300 - Index used to define the order of execution */ order: 300, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: preventOverflow, /** * @prop {Array} [priority=['left','right','top','bottom']] * Popper will try to prevent overflow following these priorities by default, * then, it could overflow on the left and on top of the `boundariesElement` */ priority: ['left', 'right', 'top', 'bottom'], /** * @prop {number} padding=5 * Amount of pixel used to define a minimum distance between the boundaries * and the popper. This makes sure the popper always has a little padding * between the edges of its container */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='scrollParent' * Boundaries used by the modifier. Can be `scrollParent`, `window`, * `viewport` or any DOM element. */ boundariesElement: 'scrollParent' }, /** * Modifier used to make sure the reference and its popper stay near each other * without leaving any gap between the two. Especially useful when the arrow is * enabled and you want to ensure that it points to its reference element. * It cares only about the first axis. You can still have poppers with margin * between the popper and its reference element. * @memberof modifiers * @inner */ keepTogether: { /** @prop {number} order=400 - Index used to define the order of execution */ order: 400, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: keepTogether }, /** * This modifier is used to move the `arrowElement` of the popper to make * sure it is positioned between the reference element and its popper element. * It will read the outer size of the `arrowElement` node to detect how many * pixels of conjunction are needed. * * It has no effect if no `arrowElement` is provided. * @memberof modifiers * @inner */ arrow: { /** @prop {number} order=500 - Index used to define the order of execution */ order: 500, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: arrow, /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ element: '[x-arrow]' }, /** * Modifier used to flip the popper's placement when it starts to overlap its * reference element. * * Requires the `preventOverflow` modifier before it in order to work. * * **NOTE:** this modifier will interrupt the current update cycle and will * restart it if it detects the need to flip the placement. * @memberof modifiers * @inner */ flip: { /** @prop {number} order=600 - Index used to define the order of execution */ order: 600, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: flip, /** * @prop {String|Array} behavior='flip' * The behavior used to change the popper's placement. It can be one of * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid * placements (with optional variations) */ behavior: 'flip', /** * @prop {number} padding=5 * The popper will flip if it hits the edges of the `boundariesElement` */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='viewport' * The element which will define the boundaries of the popper position. * The popper will never be placed outside of the defined boundaries * (except if `keepTogether` is enabled) */ boundariesElement: 'viewport' }, /** * Modifier used to make the popper flow toward the inner of the reference element. * By default, when this modifier is disabled, the popper will be placed outside * the reference element. * @memberof modifiers * @inner */ inner: { /** @prop {number} order=700 - Index used to define the order of execution */ order: 700, /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ enabled: false, /** @prop {ModifierFn} */ fn: inner }, /** * Modifier used to hide the popper when its reference element is outside of the * popper boundaries. It will set a `x-out-of-boundaries` attribute which can * be used to hide with a CSS selector the popper when its reference is * out of boundaries. * * Requires the `preventOverflow` modifier before it in order to work. * @memberof modifiers * @inner */ hide: { /** @prop {number} order=800 - Index used to define the order of execution */ order: 800, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: hide }, /** * Computes the style that will be applied to the popper element to gets * properly positioned. * * Note that this modifier will not touch the DOM, it just prepares the styles * so that `applyStyle` modifier can apply it. This separation is useful * in case you need to replace `applyStyle` with a custom implementation. * * This modifier has `850` as `order` value to maintain backward compatibility * with previous versions of Popper.js. Expect the modifiers ordering method * to change in future major versions of the library. * * @memberof modifiers * @inner */ computeStyle: { /** @prop {number} order=850 - Index used to define the order of execution */ order: 850, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: computeStyle, /** * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: true, /** * @prop {string} [x='bottom'] * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. * Change this if your popper should grow in a direction different from `bottom` */ x: 'bottom', /** * @prop {string} [x='left'] * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. * Change this if your popper should grow in a direction different from `right` */ y: 'right' }, /** * Applies the computed styles to the popper element. * * All the DOM manipulations are limited to this modifier. This is useful in case * you want to integrate Popper.js inside a framework or view library and you * want to delegate all the DOM manipulations to it. * * Note that if you disable this modifier, you must make sure the popper element * has its position set to `absolute` before Popper.js can do its work! * * Just disable this modifier and define your own to achieve the desired effect. * * @memberof modifiers * @inner */ applyStyle: { /** @prop {number} order=900 - Index used to define the order of execution */ order: 900, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: applyStyle, /** @prop {Function} */ onLoad: applyStyleOnLoad, /** * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: undefined } }; /** * The `dataObject` is an object containing all the information used by Popper.js. * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks. * @name dataObject * @property {Object} data.instance The Popper.js instance * @property {String} data.placement Placement applied to popper * @property {String} data.originalPlacement Placement originally defined on init * @property {Boolean} data.flipped True if popper has been flipped by flip modifier * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.boundaries Offsets of the popper boundaries * @property {Object} data.offsets The measurements of popper, reference and arrow elements * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 */ /** * Default options provided to Popper.js constructor.
* These can be overridden using the `options` argument of Popper.js.
* To override an option, simply pass an object with the same * structure of the `options` object, as the 3rd argument. For example: * ``` * new Popper(ref, pop, { * modifiers: { * preventOverflow: { enabled: false } * } * }) * ``` * @type {Object} * @static * @memberof Popper */ var Defaults = { /** * Popper's placement. * @prop {Popper.placements} placement='bottom' */ placement: 'bottom', /** * Set this to true if you want popper to position it self in 'fixed' mode * @prop {Boolean} positionFixed=false */ positionFixed: false, /** * Whether events (resize, scroll) are initially enabled. * @prop {Boolean} eventsEnabled=true */ eventsEnabled: true, /** * Set to true if you want to automatically remove the popper when * you call the `destroy` method. * @prop {Boolean} removeOnDestroy=false */ removeOnDestroy: false, /** * Callback called when the popper is created.
* By default, it is set to no-op.
* Access Popper.js instance with `data.instance`. * @prop {onCreate} */ onCreate: function onCreate() {}, /** * Callback called when the popper is updated. This callback is not called * on the initialization/creation of the popper, but only on subsequent * updates.
* By default, it is set to no-op.
* Access Popper.js instance with `data.instance`. * @prop {onUpdate} */ onUpdate: function onUpdate() {}, /** * List of modifiers used to modify the offsets before they are applied to the popper. * They provide most of the functionalities of Popper.js. * @prop {modifiers} */ modifiers: modifiers }; /** * @callback onCreate * @param {dataObject} data */ /** * @callback onUpdate * @param {dataObject} data */ // Utils // Methods var Popper = function () { /** * Creates a new Popper.js instance. * @class Popper * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper * @param {HTMLElement} popper - The HTML element used as the popper * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) * @return {Object} instance - The generated Popper.js instance */ function Popper(reference, popper) { var _this = this; var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; classCallCheck(this, Popper); this.scheduleUpdate = function () { return requestAnimationFrame(_this.update); }; // make update() debounced, so that it only runs at most once-per-tick this.update = debounce(this.update.bind(this)); // with {} we create a new object with the options inside it this.options = _extends({}, Popper.Defaults, options); // init state this.state = { isDestroyed: false, isCreated: false, scrollParents: [] }; // get reference and popper elements (allow jQuery wrappers) this.reference = reference && reference.jquery ? reference[0] : reference; this.popper = popper && popper.jquery ? popper[0] : popper; // Deep merge modifiers options this.options.modifiers = {}; Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); }); // Refactoring modifiers' list (Object => Array) this.modifiers = Object.keys(this.options.modifiers).map(function (name) { return _extends({ name: name }, _this.options.modifiers[name]); }) // sort the modifiers by order .sort(function (a, b) { return a.order - b.order; }); // modifiers have the ability to execute arbitrary code when Popper.js get inited // such code is executed in the same order of its modifier // they could add new properties to their options configuration // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! this.modifiers.forEach(function (modifierOptions) { if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) { modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); } }); // fire the first update to position the popper in the right place this.update(); var eventsEnabled = this.options.eventsEnabled; if (eventsEnabled) { // setup event listeners, they will take care of update the position in specific situations this.enableEventListeners(); } this.state.eventsEnabled = eventsEnabled; } // We can't use class properties because they don't get listed in the // class prototype and break stuff like Sinon stubs createClass(Popper, [{ key: 'update', value: function update$$1() { return update.call(this); } }, { key: 'destroy', value: function destroy$$1() { return destroy.call(this); } }, { key: 'enableEventListeners', value: function enableEventListeners$$1() { return enableEventListeners.call(this); } }, { key: 'disableEventListeners', value: function disableEventListeners$$1() { return disableEventListeners.call(this); } /** * Schedules an update. It will run on the next UI update available. * @method scheduleUpdate * @memberof Popper */ /** * Collection of utilities useful when writing custom modifiers. * Starting from version 1.7, this method is available only if you * include `popper-utils.js` before `popper.js`. * * **DEPRECATION**: This way to access PopperUtils is deprecated * and will be removed in v2! Use the PopperUtils module directly instead. * Due to the high instability of the methods contained in Utils, we can't * guarantee them to follow semver. Use them at your own risk! * @static * @private * @type {Object} * @deprecated since version 1.8 * @member Utils * @memberof Popper */ }]); return Popper; }(); /** * The `referenceObject` is an object that provides an interface compatible with Popper.js * and lets you use it as replacement of a real DOM node.
* You can use this method to position a popper relatively to a set of coordinates * in case you don't have a DOM node to use as reference. * * ``` * new Popper(referenceObject, popperNode); * ``` * * NB: This feature isn't supported in Internet Explorer 10. * @name referenceObject * @property {Function} data.getBoundingClientRect * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. * @property {number} data.clientWidth * An ES6 getter that will return the width of the virtual reference element. * @property {number} data.clientHeight * An ES6 getter that will return the height of the virtual reference element. */ Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; Popper.placements = placements; Popper.Defaults = Defaults; return Popper; }))); //# sourceMappingURL=popper.js.map; // source --> https://czyszczenieimonitoringkanalizacji.pl/wp-content/themes/pure/3rd/bootstrap/js/bootstrap.js?ver=5.5.11 /*! * Bootstrap v4.1.3 (https://getbootstrap.com/) * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) */ (function (global, factory) { typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery'), require('popper.js')) : typeof define === 'function' && define.amd ? define(['exports', 'jquery', 'popper.js'], factory) : (factory((global.bootstrap = {}),global.jQuery,global.Popper)); }(this, (function (exports,$,Popper) { 'use strict'; $ = $ && $.hasOwnProperty('default') ? $['default'] : $; Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper; function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } function _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; } function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; var ownKeys = Object.keys(source); if (typeof Object.getOwnPropertySymbols === 'function') { ownKeys = ownKeys.concat(Object.getOwnPropertySymbols(source).filter(function (sym) { return Object.getOwnPropertyDescriptor(source, sym).enumerable; })); } ownKeys.forEach(function (key) { _defineProperty(target, key, source[key]); }); } return target; } function _inheritsLoose(subClass, superClass) { subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass; } /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): util.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Util = function ($$$1) { /** * ------------------------------------------------------------------------ * Private TransitionEnd Helpers * ------------------------------------------------------------------------ */ var TRANSITION_END = 'transitionend'; var MAX_UID = 1000000; var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp) function toType(obj) { return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase(); } function getSpecialTransitionEndEvent() { return { bindType: TRANSITION_END, delegateType: TRANSITION_END, handle: function handle(event) { if ($$$1(event.target).is(this)) { return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params } return undefined; // eslint-disable-line no-undefined } }; } function transitionEndEmulator(duration) { var _this = this; var called = false; $$$1(this).one(Util.TRANSITION_END, function () { called = true; }); setTimeout(function () { if (!called) { Util.triggerTransitionEnd(_this); } }, duration); return this; } function setTransitionEndSupport() { $$$1.fn.emulateTransitionEnd = transitionEndEmulator; $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent(); } /** * -------------------------------------------------------------------------- * Public Util Api * -------------------------------------------------------------------------- */ var Util = { TRANSITION_END: 'bsTransitionEnd', getUID: function getUID(prefix) { do { // eslint-disable-next-line no-bitwise prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here } while (document.getElementById(prefix)); return prefix; }, getSelectorFromElement: function getSelectorFromElement(element) { var selector = element.getAttribute('data-target'); if (!selector || selector === '#') { selector = element.getAttribute('href') || ''; } try { return document.querySelector(selector) ? selector : null; } catch (err) { return null; } }, getTransitionDurationFromElement: function getTransitionDurationFromElement(element) { if (!element) { return 0; } // Get transition-duration of the element var transitionDuration = $$$1(element).css('transition-duration'); var floatTransitionDuration = parseFloat(transitionDuration); // Return 0 if element or transition duration is not found if (!floatTransitionDuration) { return 0; } // If multiple durations are defined, take the first transitionDuration = transitionDuration.split(',')[0]; return parseFloat(transitionDuration) * MILLISECONDS_MULTIPLIER; }, reflow: function reflow(element) { return element.offsetHeight; }, triggerTransitionEnd: function triggerTransitionEnd(element) { $$$1(element).trigger(TRANSITION_END); }, // TODO: Remove in v5 supportsTransitionEnd: function supportsTransitionEnd() { return Boolean(TRANSITION_END); }, isElement: function isElement(obj) { return (obj[0] || obj).nodeType; }, typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) { for (var property in configTypes) { if (Object.prototype.hasOwnProperty.call(configTypes, property)) { var expectedTypes = configTypes[property]; var value = config[property]; var valueType = value && Util.isElement(value) ? 'element' : toType(value); if (!new RegExp(expectedTypes).test(valueType)) { throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\".")); } } } } }; setTransitionEndSupport(); return Util; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): alert.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Alert = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'alert'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.alert'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var Selector = { DISMISS: '[data-dismiss="alert"]' }; var Event = { CLOSE: "close" + EVENT_KEY, CLOSED: "closed" + EVENT_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY }; var ClassName = { ALERT: 'alert', FADE: 'fade', SHOW: 'show' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Alert = /*#__PURE__*/ function () { function Alert(element) { this._element = element; } // Getters var _proto = Alert.prototype; // Public _proto.close = function close(element) { var rootElement = this._element; if (element) { rootElement = this._getRootElement(element); } var customEvent = this._triggerCloseEvent(rootElement); if (customEvent.isDefaultPrevented()) { return; } this._removeElement(rootElement); }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); this._element = null; }; // Private _proto._getRootElement = function _getRootElement(element) { var selector = Util.getSelectorFromElement(element); var parent = false; if (selector) { parent = document.querySelector(selector); } if (!parent) { parent = $$$1(element).closest("." + ClassName.ALERT)[0]; } return parent; }; _proto._triggerCloseEvent = function _triggerCloseEvent(element) { var closeEvent = $$$1.Event(Event.CLOSE); $$$1(element).trigger(closeEvent); return closeEvent; }; _proto._removeElement = function _removeElement(element) { var _this = this; $$$1(element).removeClass(ClassName.SHOW); if (!$$$1(element).hasClass(ClassName.FADE)) { this._destroyElement(element); return; } var transitionDuration = Util.getTransitionDurationFromElement(element); $$$1(element).one(Util.TRANSITION_END, function (event) { return _this._destroyElement(element, event); }).emulateTransitionEnd(transitionDuration); }; _proto._destroyElement = function _destroyElement(element) { $$$1(element).detach().trigger(Event.CLOSED).remove(); }; // Static Alert._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var $element = $$$1(this); var data = $element.data(DATA_KEY); if (!data) { data = new Alert(this); $element.data(DATA_KEY, data); } if (config === 'close') { data[config](this); } }); }; Alert._handleDismiss = function _handleDismiss(alertInstance) { return function (event) { if (event) { event.preventDefault(); } alertInstance.close(this); }; }; _createClass(Alert, null, [{ key: "VERSION", get: function get() { return VERSION; } }]); return Alert; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert())); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Alert._jQueryInterface; $$$1.fn[NAME].Constructor = Alert; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Alert._jQueryInterface; }; return Alert; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): button.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Button = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'button'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.button'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var ClassName = { ACTIVE: 'active', BUTTON: 'btn', FOCUS: 'focus' }; var Selector = { DATA_TOGGLE_CARROT: '[data-toggle^="button"]', DATA_TOGGLE: '[data-toggle="buttons"]', INPUT: 'input', ACTIVE: '.active', BUTTON: '.btn' }; var Event = { CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY) /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Button = /*#__PURE__*/ function () { function Button(element) { this._element = element; } // Getters var _proto = Button.prototype; // Public _proto.toggle = function toggle() { var triggerChangeEvent = true; var addAriaPressed = true; var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0]; if (rootElement) { var input = this._element.querySelector(Selector.INPUT); if (input) { if (input.type === 'radio') { if (input.checked && this._element.classList.contains(ClassName.ACTIVE)) { triggerChangeEvent = false; } else { var activeElement = rootElement.querySelector(Selector.ACTIVE); if (activeElement) { $$$1(activeElement).removeClass(ClassName.ACTIVE); } } } if (triggerChangeEvent) { if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) { return; } input.checked = !this._element.classList.contains(ClassName.ACTIVE); $$$1(input).trigger('change'); } input.focus(); addAriaPressed = false; } } if (addAriaPressed) { this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName.ACTIVE)); } if (triggerChangeEvent) { $$$1(this._element).toggleClass(ClassName.ACTIVE); } }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); this._element = null; }; // Static Button._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); if (!data) { data = new Button(this); $$$1(this).data(DATA_KEY, data); } if (config === 'toggle') { data[config](); } }); }; _createClass(Button, null, [{ key: "VERSION", get: function get() { return VERSION; } }]); return Button; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { event.preventDefault(); var button = event.target; if (!$$$1(button).hasClass(ClassName.BUTTON)) { button = $$$1(button).closest(Selector.BUTTON); } Button._jQueryInterface.call($$$1(button), 'toggle'); }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { var button = $$$1(event.target).closest(Selector.BUTTON)[0]; $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type)); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Button._jQueryInterface; $$$1.fn[NAME].Constructor = Button; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Button._jQueryInterface; }; return Button; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): carousel.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Carousel = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'carousel'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.carousel'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch var Default = { interval: 5000, keyboard: true, slide: false, pause: 'hover', wrap: true }; var DefaultType = { interval: '(number|boolean)', keyboard: 'boolean', slide: '(boolean|string)', pause: '(string|boolean)', wrap: 'boolean' }; var Direction = { NEXT: 'next', PREV: 'prev', LEFT: 'left', RIGHT: 'right' }; var Event = { SLIDE: "slide" + EVENT_KEY, SLID: "slid" + EVENT_KEY, KEYDOWN: "keydown" + EVENT_KEY, MOUSEENTER: "mouseenter" + EVENT_KEY, MOUSELEAVE: "mouseleave" + EVENT_KEY, TOUCHEND: "touchend" + EVENT_KEY, LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY }; var ClassName = { CAROUSEL: 'carousel', ACTIVE: 'active', SLIDE: 'slide', RIGHT: 'carousel-item-right', LEFT: 'carousel-item-left', NEXT: 'carousel-item-next', PREV: 'carousel-item-prev', ITEM: 'carousel-item' }; var Selector = { ACTIVE: '.active', ACTIVE_ITEM: '.active.carousel-item', ITEM: '.carousel-item', NEXT_PREV: '.carousel-item-next, .carousel-item-prev', INDICATORS: '.carousel-indicators', DATA_SLIDE: '[data-slide], [data-slide-to]', DATA_RIDE: '[data-ride="carousel"]' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Carousel = /*#__PURE__*/ function () { function Carousel(element, config) { this._items = null; this._interval = null; this._activeElement = null; this._isPaused = false; this._isSliding = false; this.touchTimeout = null; this._config = this._getConfig(config); this._element = $$$1(element)[0]; this._indicatorsElement = this._element.querySelector(Selector.INDICATORS); this._addEventListeners(); } // Getters var _proto = Carousel.prototype; // Public _proto.next = function next() { if (!this._isSliding) { this._slide(Direction.NEXT); } }; _proto.nextWhenVisible = function nextWhenVisible() { // Don't call next when the page isn't visible // or the carousel or its parent isn't visible if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') { this.next(); } }; _proto.prev = function prev() { if (!this._isSliding) { this._slide(Direction.PREV); } }; _proto.pause = function pause(event) { if (!event) { this._isPaused = true; } if (this._element.querySelector(Selector.NEXT_PREV)) { Util.triggerTransitionEnd(this._element); this.cycle(true); } clearInterval(this._interval); this._interval = null; }; _proto.cycle = function cycle(event) { if (!event) { this._isPaused = false; } if (this._interval) { clearInterval(this._interval); this._interval = null; } if (this._config.interval && !this._isPaused) { this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval); } }; _proto.to = function to(index) { var _this = this; this._activeElement = this._element.querySelector(Selector.ACTIVE_ITEM); var activeIndex = this._getItemIndex(this._activeElement); if (index > this._items.length - 1 || index < 0) { return; } if (this._isSliding) { $$$1(this._element).one(Event.SLID, function () { return _this.to(index); }); return; } if (activeIndex === index) { this.pause(); this.cycle(); return; } var direction = index > activeIndex ? Direction.NEXT : Direction.PREV; this._slide(direction, this._items[index]); }; _proto.dispose = function dispose() { $$$1(this._element).off(EVENT_KEY); $$$1.removeData(this._element, DATA_KEY); this._items = null; this._config = null; this._element = null; this._interval = null; this._isPaused = null; this._isSliding = null; this._activeElement = null; this._indicatorsElement = null; }; // Private _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, Default, config); Util.typeCheckConfig(NAME, config, DefaultType); return config; }; _proto._addEventListeners = function _addEventListeners() { var _this2 = this; if (this._config.keyboard) { $$$1(this._element).on(Event.KEYDOWN, function (event) { return _this2._keydown(event); }); } if (this._config.pause === 'hover') { $$$1(this._element).on(Event.MOUSEENTER, function (event) { return _this2.pause(event); }).on(Event.MOUSELEAVE, function (event) { return _this2.cycle(event); }); if ('ontouchstart' in document.documentElement) { // If it's a touch-enabled device, mouseenter/leave are fired as // part of the mouse compatibility events on first tap - the carousel // would stop cycling until user tapped out of it; // here, we listen for touchend, explicitly pause the carousel // (as if it's the second time we tap on it, mouseenter compat event // is NOT fired) and after a timeout (to allow for mouse compatibility // events to fire) we explicitly restart cycling $$$1(this._element).on(Event.TOUCHEND, function () { _this2.pause(); if (_this2.touchTimeout) { clearTimeout(_this2.touchTimeout); } _this2.touchTimeout = setTimeout(function (event) { return _this2.cycle(event); }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval); }); } } }; _proto._keydown = function _keydown(event) { if (/input|textarea/i.test(event.target.tagName)) { return; } switch (event.which) { case ARROW_LEFT_KEYCODE: event.preventDefault(); this.prev(); break; case ARROW_RIGHT_KEYCODE: event.preventDefault(); this.next(); break; default: } }; _proto._getItemIndex = function _getItemIndex(element) { this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector.ITEM)) : []; return this._items.indexOf(element); }; _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) { var isNextDirection = direction === Direction.NEXT; var isPrevDirection = direction === Direction.PREV; var activeIndex = this._getItemIndex(activeElement); var lastItemIndex = this._items.length - 1; var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex; if (isGoingToWrap && !this._config.wrap) { return activeElement; } var delta = direction === Direction.PREV ? -1 : 1; var itemIndex = (activeIndex + delta) % this._items.length; return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex]; }; _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) { var targetIndex = this._getItemIndex(relatedTarget); var fromIndex = this._getItemIndex(this._element.querySelector(Selector.ACTIVE_ITEM)); var slideEvent = $$$1.Event(Event.SLIDE, { relatedTarget: relatedTarget, direction: eventDirectionName, from: fromIndex, to: targetIndex }); $$$1(this._element).trigger(slideEvent); return slideEvent; }; _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) { if (this._indicatorsElement) { var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector.ACTIVE)); $$$1(indicators).removeClass(ClassName.ACTIVE); var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)]; if (nextIndicator) { $$$1(nextIndicator).addClass(ClassName.ACTIVE); } } }; _proto._slide = function _slide(direction, element) { var _this3 = this; var activeElement = this._element.querySelector(Selector.ACTIVE_ITEM); var activeElementIndex = this._getItemIndex(activeElement); var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement); var nextElementIndex = this._getItemIndex(nextElement); var isCycling = Boolean(this._interval); var directionalClassName; var orderClassName; var eventDirectionName; if (direction === Direction.NEXT) { directionalClassName = ClassName.LEFT; orderClassName = ClassName.NEXT; eventDirectionName = Direction.LEFT; } else { directionalClassName = ClassName.RIGHT; orderClassName = ClassName.PREV; eventDirectionName = Direction.RIGHT; } if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) { this._isSliding = false; return; } var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName); if (slideEvent.isDefaultPrevented()) { return; } if (!activeElement || !nextElement) { // Some weirdness is happening, so we bail return; } this._isSliding = true; if (isCycling) { this.pause(); } this._setActiveIndicatorElement(nextElement); var slidEvent = $$$1.Event(Event.SLID, { relatedTarget: nextElement, direction: eventDirectionName, from: activeElementIndex, to: nextElementIndex }); if ($$$1(this._element).hasClass(ClassName.SLIDE)) { $$$1(nextElement).addClass(orderClassName); Util.reflow(nextElement); $$$1(activeElement).addClass(directionalClassName); $$$1(nextElement).addClass(directionalClassName); var transitionDuration = Util.getTransitionDurationFromElement(activeElement); $$$1(activeElement).one(Util.TRANSITION_END, function () { $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE); $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName); _this3._isSliding = false; setTimeout(function () { return $$$1(_this3._element).trigger(slidEvent); }, 0); }).emulateTransitionEnd(transitionDuration); } else { $$$1(activeElement).removeClass(ClassName.ACTIVE); $$$1(nextElement).addClass(ClassName.ACTIVE); this._isSliding = false; $$$1(this._element).trigger(slidEvent); } if (isCycling) { this.cycle(); } }; // Static Carousel._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); var _config = _objectSpread({}, Default, $$$1(this).data()); if (typeof config === 'object') { _config = _objectSpread({}, _config, config); } var action = typeof config === 'string' ? config : _config.slide; if (!data) { data = new Carousel(this, _config); $$$1(this).data(DATA_KEY, data); } if (typeof config === 'number') { data.to(config); } else if (typeof action === 'string') { if (typeof data[action] === 'undefined') { throw new TypeError("No method named \"" + action + "\""); } data[action](); } else if (_config.interval) { data.pause(); data.cycle(); } }); }; Carousel._dataApiClickHandler = function _dataApiClickHandler(event) { var selector = Util.getSelectorFromElement(this); if (!selector) { return; } var target = $$$1(selector)[0]; if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) { return; } var config = _objectSpread({}, $$$1(target).data(), $$$1(this).data()); var slideIndex = this.getAttribute('data-slide-to'); if (slideIndex) { config.interval = false; } Carousel._jQueryInterface.call($$$1(target), config); if (slideIndex) { $$$1(target).data(DATA_KEY).to(slideIndex); } event.preventDefault(); }; _createClass(Carousel, null, [{ key: "VERSION", get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }]); return Carousel; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler); $$$1(window).on(Event.LOAD_DATA_API, function () { var carousels = [].slice.call(document.querySelectorAll(Selector.DATA_RIDE)); for (var i = 0, len = carousels.length; i < len; i++) { var $carousel = $$$1(carousels[i]); Carousel._jQueryInterface.call($carousel, $carousel.data()); } }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Carousel._jQueryInterface; $$$1.fn[NAME].Constructor = Carousel; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Carousel._jQueryInterface; }; return Carousel; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): collapse.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Collapse = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'collapse'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.collapse'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var Default = { toggle: true, parent: '' }; var DefaultType = { toggle: 'boolean', parent: '(string|element)' }; var Event = { SHOW: "show" + EVENT_KEY, SHOWN: "shown" + EVENT_KEY, HIDE: "hide" + EVENT_KEY, HIDDEN: "hidden" + EVENT_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY }; var ClassName = { SHOW: 'show', COLLAPSE: 'collapse', COLLAPSING: 'collapsing', COLLAPSED: 'collapsed' }; var Dimension = { WIDTH: 'width', HEIGHT: 'height' }; var Selector = { ACTIVES: '.show, .collapsing', DATA_TOGGLE: '[data-toggle="collapse"]' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Collapse = /*#__PURE__*/ function () { function Collapse(element, config) { this._isTransitioning = false; this._element = element; this._config = this._getConfig(config); this._triggerArray = $$$1.makeArray(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]"))); var toggleList = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE)); for (var i = 0, len = toggleList.length; i < len; i++) { var elem = toggleList[i]; var selector = Util.getSelectorFromElement(elem); var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) { return foundElem === element; }); if (selector !== null && filterElement.length > 0) { this._selector = selector; this._triggerArray.push(elem); } } this._parent = this._config.parent ? this._getParent() : null; if (!this._config.parent) { this._addAriaAndCollapsedClass(this._element, this._triggerArray); } if (this._config.toggle) { this.toggle(); } } // Getters var _proto = Collapse.prototype; // Public _proto.toggle = function toggle() { if ($$$1(this._element).hasClass(ClassName.SHOW)) { this.hide(); } else { this.show(); } }; _proto.show = function show() { var _this = this; if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) { return; } var actives; var activesData; if (this._parent) { actives = [].slice.call(this._parent.querySelectorAll(Selector.ACTIVES)).filter(function (elem) { return elem.getAttribute('data-parent') === _this._config.parent; }); if (actives.length === 0) { actives = null; } } if (actives) { activesData = $$$1(actives).not(this._selector).data(DATA_KEY); if (activesData && activesData._isTransitioning) { return; } } var startEvent = $$$1.Event(Event.SHOW); $$$1(this._element).trigger(startEvent); if (startEvent.isDefaultPrevented()) { return; } if (actives) { Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide'); if (!activesData) { $$$1(actives).data(DATA_KEY, null); } } var dimension = this._getDimension(); $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING); this._element.style[dimension] = 0; if (this._triggerArray.length) { $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true); } this.setTransitioning(true); var complete = function complete() { $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW); _this._element.style[dimension] = ''; _this.setTransitioning(false); $$$1(_this._element).trigger(Event.SHOWN); }; var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); var scrollSize = "scroll" + capitalizedDimension; var transitionDuration = Util.getTransitionDurationFromElement(this._element); $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); this._element.style[dimension] = this._element[scrollSize] + "px"; }; _proto.hide = function hide() { var _this2 = this; if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) { return; } var startEvent = $$$1.Event(Event.HIDE); $$$1(this._element).trigger(startEvent); if (startEvent.isDefaultPrevented()) { return; } var dimension = this._getDimension(); this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px"; Util.reflow(this._element); $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW); var triggerArrayLength = this._triggerArray.length; if (triggerArrayLength > 0) { for (var i = 0; i < triggerArrayLength; i++) { var trigger = this._triggerArray[i]; var selector = Util.getSelectorFromElement(trigger); if (selector !== null) { var $elem = $$$1([].slice.call(document.querySelectorAll(selector))); if (!$elem.hasClass(ClassName.SHOW)) { $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false); } } } } this.setTransitioning(true); var complete = function complete() { _this2.setTransitioning(false); $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN); }; this._element.style[dimension] = ''; var transitionDuration = Util.getTransitionDurationFromElement(this._element); $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); }; _proto.setTransitioning = function setTransitioning(isTransitioning) { this._isTransitioning = isTransitioning; }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); this._config = null; this._parent = null; this._element = null; this._triggerArray = null; this._isTransitioning = null; }; // Private _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, Default, config); config.toggle = Boolean(config.toggle); // Coerce string values Util.typeCheckConfig(NAME, config, DefaultType); return config; }; _proto._getDimension = function _getDimension() { var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH); return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT; }; _proto._getParent = function _getParent() { var _this3 = this; var parent = null; if (Util.isElement(this._config.parent)) { parent = this._config.parent; // It's a jQuery object if (typeof this._config.parent.jquery !== 'undefined') { parent = this._config.parent[0]; } } else { parent = document.querySelector(this._config.parent); } var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]"; var children = [].slice.call(parent.querySelectorAll(selector)); $$$1(children).each(function (i, element) { _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]); }); return parent; }; _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) { if (element) { var isOpen = $$$1(element).hasClass(ClassName.SHOW); if (triggerArray.length) { $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen); } } }; // Static Collapse._getTargetFromElement = function _getTargetFromElement(element) { var selector = Util.getSelectorFromElement(element); return selector ? document.querySelector(selector) : null; }; Collapse._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var $this = $$$1(this); var data = $this.data(DATA_KEY); var _config = _objectSpread({}, Default, $this.data(), typeof config === 'object' && config ? config : {}); if (!data && _config.toggle && /show|hide/.test(config)) { _config.toggle = false; } if (!data) { data = new Collapse(this, _config); $this.data(DATA_KEY, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Collapse, null, [{ key: "VERSION", get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }]); return Collapse; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { // preventDefault only for elements (which change the URL) not inside the collapsible element if (event.currentTarget.tagName === 'A') { event.preventDefault(); } var $trigger = $$$1(this); var selector = Util.getSelectorFromElement(this); var selectors = [].slice.call(document.querySelectorAll(selector)); $$$1(selectors).each(function () { var $target = $$$1(this); var data = $target.data(DATA_KEY); var config = data ? 'toggle' : $trigger.data(); Collapse._jQueryInterface.call($target, config); }); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Collapse._jQueryInterface; $$$1.fn[NAME].Constructor = Collapse; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Collapse._jQueryInterface; }; return Collapse; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): dropdown.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Dropdown = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'dropdown'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.dropdown'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse) var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE); var Event = { HIDE: "hide" + EVENT_KEY, HIDDEN: "hidden" + EVENT_KEY, SHOW: "show" + EVENT_KEY, SHOWN: "shown" + EVENT_KEY, CLICK: "click" + EVENT_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY, KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY }; var ClassName = { DISABLED: 'disabled', SHOW: 'show', DROPUP: 'dropup', DROPRIGHT: 'dropright', DROPLEFT: 'dropleft', MENURIGHT: 'dropdown-menu-right', MENULEFT: 'dropdown-menu-left', POSITION_STATIC: 'position-static' }; var Selector = { DATA_TOGGLE: '[data-toggle="dropdown"]', FORM_CHILD: '.dropdown form', MENU: '.dropdown-menu', NAVBAR_NAV: '.navbar-nav', VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)' }; var AttachmentMap = { TOP: 'top-start', TOPEND: 'top-end', BOTTOM: 'bottom-start', BOTTOMEND: 'bottom-end', RIGHT: 'right-start', RIGHTEND: 'right-end', LEFT: 'left-start', LEFTEND: 'left-end' }; var Default = { offset: 0, flip: true, boundary: 'scrollParent', reference: 'toggle', display: 'dynamic' }; var DefaultType = { offset: '(number|string|function)', flip: 'boolean', boundary: '(string|element)', reference: '(string|element)', display: 'string' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Dropdown = /*#__PURE__*/ function () { function Dropdown(element, config) { this._element = element; this._popper = null; this._config = this._getConfig(config); this._menu = this._getMenuElement(); this._inNavbar = this._detectNavbar(); this._addEventListeners(); } // Getters var _proto = Dropdown.prototype; // Public _proto.toggle = function toggle() { if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) { return; } var parent = Dropdown._getParentFromElement(this._element); var isActive = $$$1(this._menu).hasClass(ClassName.SHOW); Dropdown._clearMenus(); if (isActive) { return; } var relatedTarget = { relatedTarget: this._element }; var showEvent = $$$1.Event(Event.SHOW, relatedTarget); $$$1(parent).trigger(showEvent); if (showEvent.isDefaultPrevented()) { return; } // Disable totally Popper.js for Dropdown in Navbar if (!this._inNavbar) { /** * Check for Popper dependency * Popper - https://popper.js.org */ if (typeof Popper === 'undefined') { throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)'); } var referenceElement = this._element; if (this._config.reference === 'parent') { referenceElement = parent; } else if (Util.isElement(this._config.reference)) { referenceElement = this._config.reference; // Check if it's jQuery element if (typeof this._config.reference.jquery !== 'undefined') { referenceElement = this._config.reference[0]; } } // If boundary is not `scrollParent`, then set position to `static` // to allow the menu to "escape" the scroll parent's boundaries // https://github.com/twbs/bootstrap/issues/24251 if (this._config.boundary !== 'scrollParent') { $$$1(parent).addClass(ClassName.POSITION_STATIC); } this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig()); } // If this is a touch-enabled device we add extra // empty mouseover listeners to the body's immediate children; // only needed because of broken event delegation on iOS // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) { $$$1(document.body).children().on('mouseover', null, $$$1.noop); } this._element.focus(); this._element.setAttribute('aria-expanded', true); $$$1(this._menu).toggleClass(ClassName.SHOW); $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget)); }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); $$$1(this._element).off(EVENT_KEY); this._element = null; this._menu = null; if (this._popper !== null) { this._popper.destroy(); this._popper = null; } }; _proto.update = function update() { this._inNavbar = this._detectNavbar(); if (this._popper !== null) { this._popper.scheduleUpdate(); } }; // Private _proto._addEventListeners = function _addEventListeners() { var _this = this; $$$1(this._element).on(Event.CLICK, function (event) { event.preventDefault(); event.stopPropagation(); _this.toggle(); }); }; _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, this.constructor.Default, $$$1(this._element).data(), config); Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); return config; }; _proto._getMenuElement = function _getMenuElement() { if (!this._menu) { var parent = Dropdown._getParentFromElement(this._element); if (parent) { this._menu = parent.querySelector(Selector.MENU); } } return this._menu; }; _proto._getPlacement = function _getPlacement() { var $parentDropdown = $$$1(this._element.parentNode); var placement = AttachmentMap.BOTTOM; // Handle dropup if ($parentDropdown.hasClass(ClassName.DROPUP)) { placement = AttachmentMap.TOP; if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { placement = AttachmentMap.TOPEND; } } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) { placement = AttachmentMap.RIGHT; } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) { placement = AttachmentMap.LEFT; } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { placement = AttachmentMap.BOTTOMEND; } return placement; }; _proto._detectNavbar = function _detectNavbar() { return $$$1(this._element).closest('.navbar').length > 0; }; _proto._getPopperConfig = function _getPopperConfig() { var _this2 = this; var offsetConf = {}; if (typeof this._config.offset === 'function') { offsetConf.fn = function (data) { data.offsets = _objectSpread({}, data.offsets, _this2._config.offset(data.offsets) || {}); return data; }; } else { offsetConf.offset = this._config.offset; } var popperConfig = { placement: this._getPlacement(), modifiers: { offset: offsetConf, flip: { enabled: this._config.flip }, preventOverflow: { boundariesElement: this._config.boundary } } // Disable Popper.js if we have a static display }; if (this._config.display === 'static') { popperConfig.modifiers.applyStyle = { enabled: false }; } return popperConfig; }; // Static Dropdown._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); var _config = typeof config === 'object' ? config : null; if (!data) { data = new Dropdown(this, _config); $$$1(this).data(DATA_KEY, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; Dropdown._clearMenus = function _clearMenus(event) { if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) { return; } var toggles = [].slice.call(document.querySelectorAll(Selector.DATA_TOGGLE)); for (var i = 0, len = toggles.length; i < len; i++) { var parent = Dropdown._getParentFromElement(toggles[i]); var context = $$$1(toggles[i]).data(DATA_KEY); var relatedTarget = { relatedTarget: toggles[i] }; if (event && event.type === 'click') { relatedTarget.clickEvent = event; } if (!context) { continue; } var dropdownMenu = context._menu; if (!$$$1(parent).hasClass(ClassName.SHOW)) { continue; } if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) { continue; } var hideEvent = $$$1.Event(Event.HIDE, relatedTarget); $$$1(parent).trigger(hideEvent); if (hideEvent.isDefaultPrevented()) { continue; } // If this is a touch-enabled device we remove the extra // empty mouseover listeners we added for iOS support if ('ontouchstart' in document.documentElement) { $$$1(document.body).children().off('mouseover', null, $$$1.noop); } toggles[i].setAttribute('aria-expanded', 'false'); $$$1(dropdownMenu).removeClass(ClassName.SHOW); $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget)); } }; Dropdown._getParentFromElement = function _getParentFromElement(element) { var parent; var selector = Util.getSelectorFromElement(element); if (selector) { parent = document.querySelector(selector); } return parent || element.parentNode; }; // eslint-disable-next-line complexity Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) { // If not input/textarea: // - And not a key in REGEXP_KEYDOWN => not a dropdown command // If input/textarea: // - If space key => not a dropdown command // - If key is other than escape // - If key is not up or down => not a dropdown command // - If trigger inside the menu => not a dropdown command if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) { return; } event.preventDefault(); event.stopPropagation(); if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) { return; } var parent = Dropdown._getParentFromElement(this); var isActive = $$$1(parent).hasClass(ClassName.SHOW); if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) { if (event.which === ESCAPE_KEYCODE) { var toggle = parent.querySelector(Selector.DATA_TOGGLE); $$$1(toggle).trigger('focus'); } $$$1(this).trigger('click'); return; } var items = [].slice.call(parent.querySelectorAll(Selector.VISIBLE_ITEMS)); if (items.length === 0) { return; } var index = items.indexOf(event.target); if (event.which === ARROW_UP_KEYCODE && index > 0) { // Up index--; } if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) { // Down index++; } if (index < 0) { index = 0; } items[index].focus(); }; _createClass(Dropdown, null, [{ key: "VERSION", get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }, { key: "DefaultType", get: function get() { return DefaultType; } }]); return Dropdown; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { event.preventDefault(); event.stopPropagation(); Dropdown._jQueryInterface.call($$$1(this), 'toggle'); }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) { e.stopPropagation(); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Dropdown._jQueryInterface; $$$1.fn[NAME].Constructor = Dropdown; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Dropdown._jQueryInterface; }; return Dropdown; }($, Popper); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): modal.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Modal = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'modal'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.modal'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key var Default = { backdrop: true, keyboard: true, focus: true, show: true }; var DefaultType = { backdrop: '(boolean|string)', keyboard: 'boolean', focus: 'boolean', show: 'boolean' }; var Event = { HIDE: "hide" + EVENT_KEY, HIDDEN: "hidden" + EVENT_KEY, SHOW: "show" + EVENT_KEY, SHOWN: "shown" + EVENT_KEY, FOCUSIN: "focusin" + EVENT_KEY, RESIZE: "resize" + EVENT_KEY, CLICK_DISMISS: "click.dismiss" + EVENT_KEY, KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY, MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY, MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY }; var ClassName = { SCROLLBAR_MEASURER: 'modal-scrollbar-measure', BACKDROP: 'modal-backdrop', OPEN: 'modal-open', FADE: 'fade', SHOW: 'show' }; var Selector = { DIALOG: '.modal-dialog', DATA_TOGGLE: '[data-toggle="modal"]', DATA_DISMISS: '[data-dismiss="modal"]', FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top', STICKY_CONTENT: '.sticky-top' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Modal = /*#__PURE__*/ function () { function Modal(element, config) { this._config = this._getConfig(config); this._element = element; this._dialog = element.querySelector(Selector.DIALOG); this._backdrop = null; this._isShown = false; this._isBodyOverflowing = false; this._ignoreBackdropClick = false; this._scrollbarWidth = 0; } // Getters var _proto = Modal.prototype; // Public _proto.toggle = function toggle(relatedTarget) { return this._isShown ? this.hide() : this.show(relatedTarget); }; _proto.show = function show(relatedTarget) { var _this = this; if (this._isTransitioning || this._isShown) { return; } if ($$$1(this._element).hasClass(ClassName.FADE)) { this._isTransitioning = true; } var showEvent = $$$1.Event(Event.SHOW, { relatedTarget: relatedTarget }); $$$1(this._element).trigger(showEvent); if (this._isShown || showEvent.isDefaultPrevented()) { return; } this._isShown = true; this._checkScrollbar(); this._setScrollbar(); this._adjustDialog(); $$$1(document.body).addClass(ClassName.OPEN); this._setEscapeEvent(); this._setResizeEvent(); $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) { return _this.hide(event); }); $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () { $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) { if ($$$1(event.target).is(_this._element)) { _this._ignoreBackdropClick = true; } }); }); this._showBackdrop(function () { return _this._showElement(relatedTarget); }); }; _proto.hide = function hide(event) { var _this2 = this; if (event) { event.preventDefault(); } if (this._isTransitioning || !this._isShown) { return; } var hideEvent = $$$1.Event(Event.HIDE); $$$1(this._element).trigger(hideEvent); if (!this._isShown || hideEvent.isDefaultPrevented()) { return; } this._isShown = false; var transition = $$$1(this._element).hasClass(ClassName.FADE); if (transition) { this._isTransitioning = true; } this._setEscapeEvent(); this._setResizeEvent(); $$$1(document).off(Event.FOCUSIN); $$$1(this._element).removeClass(ClassName.SHOW); $$$1(this._element).off(Event.CLICK_DISMISS); $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS); if (transition) { var transitionDuration = Util.getTransitionDurationFromElement(this._element); $$$1(this._element).one(Util.TRANSITION_END, function (event) { return _this2._hideModal(event); }).emulateTransitionEnd(transitionDuration); } else { this._hideModal(); } }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY); this._config = null; this._element = null; this._dialog = null; this._backdrop = null; this._isShown = null; this._isBodyOverflowing = null; this._ignoreBackdropClick = null; this._scrollbarWidth = null; }; _proto.handleUpdate = function handleUpdate() { this._adjustDialog(); }; // Private _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, Default, config); Util.typeCheckConfig(NAME, config, DefaultType); return config; }; _proto._showElement = function _showElement(relatedTarget) { var _this3 = this; var transition = $$$1(this._element).hasClass(ClassName.FADE); if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) { // Don't move modal's DOM position document.body.appendChild(this._element); } this._element.style.display = 'block'; this._element.removeAttribute('aria-hidden'); this._element.scrollTop = 0; if (transition) { Util.reflow(this._element); } $$$1(this._element).addClass(ClassName.SHOW); if (this._config.focus) { this._enforceFocus(); } var shownEvent = $$$1.Event(Event.SHOWN, { relatedTarget: relatedTarget }); var transitionComplete = function transitionComplete() { if (_this3._config.focus) { _this3._element.focus(); } _this3._isTransitioning = false; $$$1(_this3._element).trigger(shownEvent); }; if (transition) { var transitionDuration = Util.getTransitionDurationFromElement(this._element); $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration); } else { transitionComplete(); } }; _proto._enforceFocus = function _enforceFocus() { var _this4 = this; $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop .on(Event.FOCUSIN, function (event) { if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) { _this4._element.focus(); } }); }; _proto._setEscapeEvent = function _setEscapeEvent() { var _this5 = this; if (this._isShown && this._config.keyboard) { $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) { if (event.which === ESCAPE_KEYCODE) { event.preventDefault(); _this5.hide(); } }); } else if (!this._isShown) { $$$1(this._element).off(Event.KEYDOWN_DISMISS); } }; _proto._setResizeEvent = function _setResizeEvent() { var _this6 = this; if (this._isShown) { $$$1(window).on(Event.RESIZE, function (event) { return _this6.handleUpdate(event); }); } else { $$$1(window).off(Event.RESIZE); } }; _proto._hideModal = function _hideModal() { var _this7 = this; this._element.style.display = 'none'; this._element.setAttribute('aria-hidden', true); this._isTransitioning = false; this._showBackdrop(function () { $$$1(document.body).removeClass(ClassName.OPEN); _this7._resetAdjustments(); _this7._resetScrollbar(); $$$1(_this7._element).trigger(Event.HIDDEN); }); }; _proto._removeBackdrop = function _removeBackdrop() { if (this._backdrop) { $$$1(this._backdrop).remove(); this._backdrop = null; } }; _proto._showBackdrop = function _showBackdrop(callback) { var _this8 = this; var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : ''; if (this._isShown && this._config.backdrop) { this._backdrop = document.createElement('div'); this._backdrop.className = ClassName.BACKDROP; if (animate) { this._backdrop.classList.add(animate); } $$$1(this._backdrop).appendTo(document.body); $$$1(this._element).on(Event.CLICK_DISMISS, function (event) { if (_this8._ignoreBackdropClick) { _this8._ignoreBackdropClick = false; return; } if (event.target !== event.currentTarget) { return; } if (_this8._config.backdrop === 'static') { _this8._element.focus(); } else { _this8.hide(); } }); if (animate) { Util.reflow(this._backdrop); } $$$1(this._backdrop).addClass(ClassName.SHOW); if (!callback) { return; } if (!animate) { callback(); return; } var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration); } else if (!this._isShown && this._backdrop) { $$$1(this._backdrop).removeClass(ClassName.SHOW); var callbackRemove = function callbackRemove() { _this8._removeBackdrop(); if (callback) { callback(); } }; if ($$$1(this._element).hasClass(ClassName.FADE)) { var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration); } else { callbackRemove(); } } else if (callback) { callback(); } }; // ---------------------------------------------------------------------- // the following methods are used to handle overflowing modals // todo (fat): these should probably be refactored out of modal.js // ---------------------------------------------------------------------- _proto._adjustDialog = function _adjustDialog() { var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; if (!this._isBodyOverflowing && isModalOverflowing) { this._element.style.paddingLeft = this._scrollbarWidth + "px"; } if (this._isBodyOverflowing && !isModalOverflowing) { this._element.style.paddingRight = this._scrollbarWidth + "px"; } }; _proto._resetAdjustments = function _resetAdjustments() { this._element.style.paddingLeft = ''; this._element.style.paddingRight = ''; }; _proto._checkScrollbar = function _checkScrollbar() { var rect = document.body.getBoundingClientRect(); this._isBodyOverflowing = rect.left + rect.right < window.innerWidth; this._scrollbarWidth = this._getScrollbarWidth(); }; _proto._setScrollbar = function _setScrollbar() { var _this9 = this; if (this._isBodyOverflowing) { // Note: DOMNode.style.paddingRight returns the actual value or '' if not set // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT)); var stickyContent = [].slice.call(document.querySelectorAll(Selector.STICKY_CONTENT)); // Adjust fixed content padding $$$1(fixedContent).each(function (index, element) { var actualPadding = element.style.paddingRight; var calculatedPadding = $$$1(element).css('padding-right'); $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px"); }); // Adjust sticky content margin $$$1(stickyContent).each(function (index, element) { var actualMargin = element.style.marginRight; var calculatedMargin = $$$1(element).css('margin-right'); $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px"); }); // Adjust body padding var actualPadding = document.body.style.paddingRight; var calculatedPadding = $$$1(document.body).css('padding-right'); $$$1(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px"); } }; _proto._resetScrollbar = function _resetScrollbar() { // Restore fixed content padding var fixedContent = [].slice.call(document.querySelectorAll(Selector.FIXED_CONTENT)); $$$1(fixedContent).each(function (index, element) { var padding = $$$1(element).data('padding-right'); $$$1(element).removeData('padding-right'); element.style.paddingRight = padding ? padding : ''; }); // Restore sticky content var elements = [].slice.call(document.querySelectorAll("" + Selector.STICKY_CONTENT)); $$$1(elements).each(function (index, element) { var margin = $$$1(element).data('margin-right'); if (typeof margin !== 'undefined') { $$$1(element).css('margin-right', margin).removeData('margin-right'); } }); // Restore body padding var padding = $$$1(document.body).data('padding-right'); $$$1(document.body).removeData('padding-right'); document.body.style.paddingRight = padding ? padding : ''; }; _proto._getScrollbarWidth = function _getScrollbarWidth() { // thx d.walsh var scrollDiv = document.createElement('div'); scrollDiv.className = ClassName.SCROLLBAR_MEASURER; document.body.appendChild(scrollDiv); var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth; document.body.removeChild(scrollDiv); return scrollbarWidth; }; // Static Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); var _config = _objectSpread({}, Default, $$$1(this).data(), typeof config === 'object' && config ? config : {}); if (!data) { data = new Modal(this, _config); $$$1(this).data(DATA_KEY, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](relatedTarget); } else if (_config.show) { data.show(relatedTarget); } }); }; _createClass(Modal, null, [{ key: "VERSION", get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }]); return Modal; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { var _this10 = this; var target; var selector = Util.getSelectorFromElement(this); if (selector) { target = document.querySelector(selector); } var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _objectSpread({}, $$$1(target).data(), $$$1(this).data()); if (this.tagName === 'A' || this.tagName === 'AREA') { event.preventDefault(); } var $target = $$$1(target).one(Event.SHOW, function (showEvent) { if (showEvent.isDefaultPrevented()) { // Only register focus restorer if modal will actually get shown return; } $target.one(Event.HIDDEN, function () { if ($$$1(_this10).is(':visible')) { _this10.focus(); } }); }); Modal._jQueryInterface.call($$$1(target), config, this); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Modal._jQueryInterface; $$$1.fn[NAME].Constructor = Modal; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Modal._jQueryInterface; }; return Modal; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): tooltip.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Tooltip = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'tooltip'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.tooltip'; var EVENT_KEY = "." + DATA_KEY; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var CLASS_PREFIX = 'bs-tooltip'; var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); var DefaultType = { animation: 'boolean', template: 'string', title: '(string|element|function)', trigger: 'string', delay: '(number|object)', html: 'boolean', selector: '(string|boolean)', placement: '(string|function)', offset: '(number|string)', container: '(string|element|boolean)', fallbackPlacement: '(string|array)', boundary: '(string|element)' }; var AttachmentMap = { AUTO: 'auto', TOP: 'top', RIGHT: 'right', BOTTOM: 'bottom', LEFT: 'left' }; var Default = { animation: true, template: '', trigger: 'hover focus', title: '', delay: 0, html: false, selector: false, placement: 'top', offset: 0, container: false, fallbackPlacement: 'flip', boundary: 'scrollParent' }; var HoverState = { SHOW: 'show', OUT: 'out' }; var Event = { HIDE: "hide" + EVENT_KEY, HIDDEN: "hidden" + EVENT_KEY, SHOW: "show" + EVENT_KEY, SHOWN: "shown" + EVENT_KEY, INSERTED: "inserted" + EVENT_KEY, CLICK: "click" + EVENT_KEY, FOCUSIN: "focusin" + EVENT_KEY, FOCUSOUT: "focusout" + EVENT_KEY, MOUSEENTER: "mouseenter" + EVENT_KEY, MOUSELEAVE: "mouseleave" + EVENT_KEY }; var ClassName = { FADE: 'fade', SHOW: 'show' }; var Selector = { TOOLTIP: '.tooltip', TOOLTIP_INNER: '.tooltip-inner', ARROW: '.arrow' }; var Trigger = { HOVER: 'hover', FOCUS: 'focus', CLICK: 'click', MANUAL: 'manual' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Tooltip = /*#__PURE__*/ function () { function Tooltip(element, config) { /** * Check for Popper dependency * Popper - https://popper.js.org */ if (typeof Popper === 'undefined') { throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)'); } // private this._isEnabled = true; this._timeout = 0; this._hoverState = ''; this._activeTrigger = {}; this._popper = null; // Protected this.element = element; this.config = this._getConfig(config); this.tip = null; this._setListeners(); } // Getters var _proto = Tooltip.prototype; // Public _proto.enable = function enable() { this._isEnabled = true; }; _proto.disable = function disable() { this._isEnabled = false; }; _proto.toggleEnabled = function toggleEnabled() { this._isEnabled = !this._isEnabled; }; _proto.toggle = function toggle(event) { if (!this._isEnabled) { return; } if (event) { var dataKey = this.constructor.DATA_KEY; var context = $$$1(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $$$1(event.currentTarget).data(dataKey, context); } context._activeTrigger.click = !context._activeTrigger.click; if (context._isWithActiveTrigger()) { context._enter(null, context); } else { context._leave(null, context); } } else { if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) { this._leave(null, this); return; } this._enter(null, this); } }; _proto.dispose = function dispose() { clearTimeout(this._timeout); $$$1.removeData(this.element, this.constructor.DATA_KEY); $$$1(this.element).off(this.constructor.EVENT_KEY); $$$1(this.element).closest('.modal').off('hide.bs.modal'); if (this.tip) { $$$1(this.tip).remove(); } this._isEnabled = null; this._timeout = null; this._hoverState = null; this._activeTrigger = null; if (this._popper !== null) { this._popper.destroy(); } this._popper = null; this.element = null; this.config = null; this.tip = null; }; _proto.show = function show() { var _this = this; if ($$$1(this.element).css('display') === 'none') { throw new Error('Please use show on visible elements'); } var showEvent = $$$1.Event(this.constructor.Event.SHOW); if (this.isWithContent() && this._isEnabled) { $$$1(this.element).trigger(showEvent); var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element); if (showEvent.isDefaultPrevented() || !isInTheDom) { return; } var tip = this.getTipElement(); var tipId = Util.getUID(this.constructor.NAME); tip.setAttribute('id', tipId); this.element.setAttribute('aria-describedby', tipId); this.setContent(); if (this.config.animation) { $$$1(tip).addClass(ClassName.FADE); } var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement; var attachment = this._getAttachment(placement); this.addAttachmentClass(attachment); var container = this.config.container === false ? document.body : $$$1(document).find(this.config.container); $$$1(tip).data(this.constructor.DATA_KEY, this); if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) { $$$1(tip).appendTo(container); } $$$1(this.element).trigger(this.constructor.Event.INSERTED); this._popper = new Popper(this.element, tip, { placement: attachment, modifiers: { offset: { offset: this.config.offset }, flip: { behavior: this.config.fallbackPlacement }, arrow: { element: Selector.ARROW }, preventOverflow: { boundariesElement: this.config.boundary } }, onCreate: function onCreate(data) { if (data.originalPlacement !== data.placement) { _this._handlePopperPlacementChange(data); } }, onUpdate: function onUpdate(data) { _this._handlePopperPlacementChange(data); } }); $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra // empty mouseover listeners to the body's immediate children; // only needed because of broken event delegation on iOS // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html if ('ontouchstart' in document.documentElement) { $$$1(document.body).children().on('mouseover', null, $$$1.noop); } var complete = function complete() { if (_this.config.animation) { _this._fixTransition(); } var prevHoverState = _this._hoverState; _this._hoverState = null; $$$1(_this.element).trigger(_this.constructor.Event.SHOWN); if (prevHoverState === HoverState.OUT) { _this._leave(null, _this); } }; if ($$$1(this.tip).hasClass(ClassName.FADE)) { var transitionDuration = Util.getTransitionDurationFromElement(this.tip); $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); } else { complete(); } } }; _proto.hide = function hide(callback) { var _this2 = this; var tip = this.getTipElement(); var hideEvent = $$$1.Event(this.constructor.Event.HIDE); var complete = function complete() { if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) { tip.parentNode.removeChild(tip); } _this2._cleanTipClass(); _this2.element.removeAttribute('aria-describedby'); $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN); if (_this2._popper !== null) { _this2._popper.destroy(); } if (callback) { callback(); } }; $$$1(this.element).trigger(hideEvent); if (hideEvent.isDefaultPrevented()) { return; } $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra // empty mouseover listeners we added for iOS support if ('ontouchstart' in document.documentElement) { $$$1(document.body).children().off('mouseover', null, $$$1.noop); } this._activeTrigger[Trigger.CLICK] = false; this._activeTrigger[Trigger.FOCUS] = false; this._activeTrigger[Trigger.HOVER] = false; if ($$$1(this.tip).hasClass(ClassName.FADE)) { var transitionDuration = Util.getTransitionDurationFromElement(tip); $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); } else { complete(); } this._hoverState = ''; }; _proto.update = function update() { if (this._popper !== null) { this._popper.scheduleUpdate(); } }; // Protected _proto.isWithContent = function isWithContent() { return Boolean(this.getTitle()); }; _proto.addAttachmentClass = function addAttachmentClass(attachment) { $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); }; _proto.getTipElement = function getTipElement() { this.tip = this.tip || $$$1(this.config.template)[0]; return this.tip; }; _proto.setContent = function setContent() { var tip = this.getTipElement(); this.setElementContent($$$1(tip.querySelectorAll(Selector.TOOLTIP_INNER)), this.getTitle()); $$$1(tip).removeClass(ClassName.FADE + " " + ClassName.SHOW); }; _proto.setElementContent = function setElementContent($element, content) { var html = this.config.html; if (typeof content === 'object' && (content.nodeType || content.jquery)) { // Content is a DOM node or a jQuery if (html) { if (!$$$1(content).parent().is($element)) { $element.empty().append(content); } } else { $element.text($$$1(content).text()); } } else { $element[html ? 'html' : 'text'](content); } }; _proto.getTitle = function getTitle() { var title = this.element.getAttribute('data-original-title'); if (!title) { title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title; } return title; }; // Private _proto._getAttachment = function _getAttachment(placement) { return AttachmentMap[placement.toUpperCase()]; }; _proto._setListeners = function _setListeners() { var _this3 = this; var triggers = this.config.trigger.split(' '); triggers.forEach(function (trigger) { if (trigger === 'click') { $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) { return _this3.toggle(event); }); } else if (trigger !== Trigger.MANUAL) { var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN; var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT; $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) { return _this3._enter(event); }).on(eventOut, _this3.config.selector, function (event) { return _this3._leave(event); }); } $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () { return _this3.hide(); }); }); if (this.config.selector) { this.config = _objectSpread({}, this.config, { trigger: 'manual', selector: '' }); } else { this._fixTitle(); } }; _proto._fixTitle = function _fixTitle() { var titleType = typeof this.element.getAttribute('data-original-title'); if (this.element.getAttribute('title') || titleType !== 'string') { this.element.setAttribute('data-original-title', this.element.getAttribute('title') || ''); this.element.setAttribute('title', ''); } }; _proto._enter = function _enter(event, context) { var dataKey = this.constructor.DATA_KEY; context = context || $$$1(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $$$1(event.currentTarget).data(dataKey, context); } if (event) { context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true; } if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) { context._hoverState = HoverState.SHOW; return; } clearTimeout(context._timeout); context._hoverState = HoverState.SHOW; if (!context.config.delay || !context.config.delay.show) { context.show(); return; } context._timeout = setTimeout(function () { if (context._hoverState === HoverState.SHOW) { context.show(); } }, context.config.delay.show); }; _proto._leave = function _leave(event, context) { var dataKey = this.constructor.DATA_KEY; context = context || $$$1(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $$$1(event.currentTarget).data(dataKey, context); } if (event) { context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false; } if (context._isWithActiveTrigger()) { return; } clearTimeout(context._timeout); context._hoverState = HoverState.OUT; if (!context.config.delay || !context.config.delay.hide) { context.hide(); return; } context._timeout = setTimeout(function () { if (context._hoverState === HoverState.OUT) { context.hide(); } }, context.config.delay.hide); }; _proto._isWithActiveTrigger = function _isWithActiveTrigger() { for (var trigger in this._activeTrigger) { if (this._activeTrigger[trigger]) { return true; } } return false; }; _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, this.constructor.Default, $$$1(this.element).data(), typeof config === 'object' && config ? config : {}); if (typeof config.delay === 'number') { config.delay = { show: config.delay, hide: config.delay }; } if (typeof config.title === 'number') { config.title = config.title.toString(); } if (typeof config.content === 'number') { config.content = config.content.toString(); } Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); return config; }; _proto._getDelegateConfig = function _getDelegateConfig() { var config = {}; if (this.config) { for (var key in this.config) { if (this.constructor.Default[key] !== this.config[key]) { config[key] = this.config[key]; } } } return config; }; _proto._cleanTipClass = function _cleanTipClass() { var $tip = $$$1(this.getTipElement()); var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); if (tabClass !== null && tabClass.length) { $tip.removeClass(tabClass.join('')); } }; _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) { var popperInstance = popperData.instance; this.tip = popperInstance.popper; this._cleanTipClass(); this.addAttachmentClass(this._getAttachment(popperData.placement)); }; _proto._fixTransition = function _fixTransition() { var tip = this.getTipElement(); var initConfigAnimation = this.config.animation; if (tip.getAttribute('x-placement') !== null) { return; } $$$1(tip).removeClass(ClassName.FADE); this.config.animation = false; this.hide(); this.show(); this.config.animation = initConfigAnimation; }; // Static Tooltip._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); var _config = typeof config === 'object' && config; if (!data && /dispose|hide/.test(config)) { return; } if (!data) { data = new Tooltip(this, _config); $$$1(this).data(DATA_KEY, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Tooltip, null, [{ key: "VERSION", get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }, { key: "NAME", get: function get() { return NAME; } }, { key: "DATA_KEY", get: function get() { return DATA_KEY; } }, { key: "Event", get: function get() { return Event; } }, { key: "EVENT_KEY", get: function get() { return EVENT_KEY; } }, { key: "DefaultType", get: function get() { return DefaultType; } }]); return Tooltip; }(); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Tooltip._jQueryInterface; $$$1.fn[NAME].Constructor = Tooltip; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Tooltip._jQueryInterface; }; return Tooltip; }($, Popper); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): popover.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var Popover = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'popover'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.popover'; var EVENT_KEY = "." + DATA_KEY; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var CLASS_PREFIX = 'bs-popover'; var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); var Default = _objectSpread({}, Tooltip.Default, { placement: 'right', trigger: 'click', content: '', template: '' }); var DefaultType = _objectSpread({}, Tooltip.DefaultType, { content: '(string|element|function)' }); var ClassName = { FADE: 'fade', SHOW: 'show' }; var Selector = { TITLE: '.popover-header', CONTENT: '.popover-body' }; var Event = { HIDE: "hide" + EVENT_KEY, HIDDEN: "hidden" + EVENT_KEY, SHOW: "show" + EVENT_KEY, SHOWN: "shown" + EVENT_KEY, INSERTED: "inserted" + EVENT_KEY, CLICK: "click" + EVENT_KEY, FOCUSIN: "focusin" + EVENT_KEY, FOCUSOUT: "focusout" + EVENT_KEY, MOUSEENTER: "mouseenter" + EVENT_KEY, MOUSELEAVE: "mouseleave" + EVENT_KEY /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var Popover = /*#__PURE__*/ function (_Tooltip) { _inheritsLoose(Popover, _Tooltip); function Popover() { return _Tooltip.apply(this, arguments) || this; } var _proto = Popover.prototype; // Overrides _proto.isWithContent = function isWithContent() { return this.getTitle() || this._getContent(); }; _proto.addAttachmentClass = function addAttachmentClass(attachment) { $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); }; _proto.getTipElement = function getTipElement() { this.tip = this.tip || $$$1(this.config.template)[0]; return this.tip; }; _proto.setContent = function setContent() { var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events this.setElementContent($tip.find(Selector.TITLE), this.getTitle()); var content = this._getContent(); if (typeof content === 'function') { content = content.call(this.element); } this.setElementContent($tip.find(Selector.CONTENT), content); $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); }; // Private _proto._getContent = function _getContent() { return this.element.getAttribute('data-content') || this.config.content; }; _proto._cleanTipClass = function _cleanTipClass() { var $tip = $$$1(this.getTipElement()); var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); if (tabClass !== null && tabClass.length > 0) { $tip.removeClass(tabClass.join('')); } }; // Static Popover._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $$$1(this).data(DATA_KEY); var _config = typeof config === 'object' ? config : null; if (!data && /destroy|hide/.test(config)) { return; } if (!data) { data = new Popover(this, _config); $$$1(this).data(DATA_KEY, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Popover, null, [{ key: "VERSION", // Getters get: function get() { return VERSION; } }, { key: "Default", get: function get() { return Default; } }, { key: "NAME", get: function get() { return NAME; } }, { key: "DATA_KEY", get: function get() { return DATA_KEY; } }, { key: "Event", get: function get() { return Event; } }, { key: "EVENT_KEY", get: function get() { return EVENT_KEY; } }, { key: "DefaultType", get: function get() { return DefaultType; } }]); return Popover; }(Tooltip); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $$$1.fn[NAME] = Popover._jQueryInterface; $$$1.fn[NAME].Constructor = Popover; $$$1.fn[NAME].noConflict = function () { $$$1.fn[NAME] = JQUERY_NO_CONFLICT; return Popover._jQueryInterface; }; return Popover; }($); /** * -------------------------------------------------------------------------- * Bootstrap (v4.1.3): scrollspy.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var ScrollSpy = function ($$$1) { /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'scrollspy'; var VERSION = '4.1.3'; var DATA_KEY = 'bs.scrollspy'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; var Default = { offset: 10, method: 'auto', target: '' }; var DefaultType = { offset: 'number', method: 'string', target: '(string|element)' }; var Event = { ACTIVATE: "activate" + EVENT_KEY, SCROLL: "scroll" + EVENT_KEY, LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY }; var ClassName = { DROPDOWN_ITEM: 'dropdown-item', DROPDOWN_MENU: 'dropdown-menu', ACTIVE: 'active' }; var Selector = { DATA_SPY: '[data-spy="scroll"]', ACTIVE: '.active', NAV_LIST_GROUP: '.nav, .list-group', NAV_LINKS: '.nav-link', NAV_ITEMS: '.nav-item', LIST_ITEMS: '.list-group-item', DROPDOWN: '.dropdown', DROPDOWN_ITEMS: '.dropdown-item', DROPDOWN_TOGGLE: '.dropdown-toggle' }; var OffsetMethod = { OFFSET: 'offset', POSITION: 'position' /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ }; var ScrollSpy = /*#__PURE__*/ function () { function ScrollSpy(element, config) { var _this = this; this._element = element; this._scrollElement = element.tagName === 'BODY' ? window : element; this._config = this._getConfig(config); this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS); this._offsets = []; this._targets = []; this._activeTarget = null; this._scrollHeight = 0; $$$1(this._scrollElement).on(Event.SCROLL, function (event) { return _this._process(event); }); this.refresh(); this._process(); } // Getters var _proto = ScrollSpy.prototype; // Public _proto.refresh = function refresh() { var _this2 = this; var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION; var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method; var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0; this._offsets = []; this._targets = []; this._scrollHeight = this._getScrollHeight(); var targets = [].slice.call(document.querySelectorAll(this._selector)); targets.map(function (element) { var target; var targetSelector = Util.getSelectorFromElement(element); if (targetSelector) { target = document.querySelector(targetSelector); } if (target) { var targetBCR = target.getBoundingClientRect(); if (targetBCR.width || targetBCR.height) { // TODO (fat): remove sketch reliance on jQuery position/offset return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector]; } } return null; }).filter(function (item) { return item; }).sort(function (a, b) { return a[0] - b[0]; }).forEach(function (item) { _this2._offsets.push(item[0]); _this2._targets.push(item[1]); }); }; _proto.dispose = function dispose() { $$$1.removeData(this._element, DATA_KEY); $$$1(this._scrollElement).off(EVENT_KEY); this._element = null; this._scrollElement = null; this._config = null; this._selector = null; this._offsets = null; this._targets = null; this._activeTarget = null; this._scrollHeight = null; }; // Private _proto._getConfig = function _getConfig(config) { config = _objectSpread({}, Default, typeof config === 'object' && config ? config : {}); if (typeof config.target !== 'string') { var id = $$$1(config.target).attr('id'); if (!id) { id = Util.getUID(NAME); $$$1(config.target).attr('id', id); } config.target = "#" + id; } Util.typeCheckConfig(NAME, config, DefaultType); return config; }; _proto._getScrollTop = function _getScrollTop() { return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop; }; _proto._getScrollHeight = function _getScrollHeight() { return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight); }; _proto._getOffsetHeight = function _getOffsetHeight() { return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height; }; _proto._process = function _process() { var scrollTop = this._getScrollTop() + this._config.offset; var scrollHeight = this._getScrollHeight(); var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight(); if (this._scrollHeight !== scrollHeight) { this.refresh(); } if (scrollTop >= maxScroll) { var target = this._targets[this._targets.length - 1]; if (this._activeTarget !== target) { this._activate(target); } return; } if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) { this._activeTarget = null; this._clear(); return; } var offsetLength = this._offsets.length; for (var i = offsetLength; i--;) { var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]); if (isActiveTarget) { this._activate(this._targets[i]); } } }; _proto._activate = function _activate(target) { this._activeTarget = target; this._clear(); var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style queries = queries.map(function (selector) { return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]"); }); var $link = $$$1([].slice.call(document.querySelectorAll(queries.join(',')))); if ($link.hasClass(ClassName.DROPDOWN_ITEM)) { $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); $link.addClass(ClassName.ACTIVE); } else { // Set triggered link as active $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active // With both

download and watch with your favorite video player!',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'',spinnerTpl:'

',errorTpl:'

',btnTpl:{download:'',zoom:'',close:'',arrowLeft:'',arrowRight:'',smallBtn:''},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded.
Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schließen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden.
Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Vergrößern"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement("fakeelement"),o={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in o)if(void 0!==n.style[t])return o[t];return"transitionend"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,i;return!(!t||t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},i=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),i)},b=function(t,e,o){var i=this;i.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(i.opts=h(i.opts,e)),n.fancybox.isMobile&&(i.opts=h(i.opts,i.opts.mobile)),i.id=i.opts.id||++c,i.currIndex=parseInt(i.opts.index,10)||0,i.prevIndex=null,i.prevPos=null,i.currPos=0,i.firstRun=!0,i.group=[],i.slides={},i.addContent(t),i.group.length&&i.init()};n.extend(b.prototype,{init:function(){var o,i,a=this,s=a.group[a.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&!1!==r.hideScrollbar&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('"),n("body").addClass("compensate-for-scrollbar")),i="",n.each(r.buttons,function(t,e){i+=r.btnTpl[e]||""}),o=n(a.translate(a,r.baseTpl.replace("{{buttons}}",i).replace("{{arrows}}",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr("id","fancybox-container-"+a.id).addClass(r.baseClass).data("FancyBox",a).appendTo(r.parentEl),a.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){a.$refs[t]=o.find(".fancybox-"+t)}),a.trigger("onInit"),a.activate(),a.jumpTo(a.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,function(t,e){return void 0===n[e]?t:n[e]})},addContent:function(t){var e,o=this,i=n.makeArray(t);n.each(i,function(t,e){var i,a,s,r,c,l={},d={};n.isPlainObject(e)?(l=e,d=e.opts||e):"object"===n.type(e)&&n(e).length?(i=n(e),d=i.data()||{},d=n.extend(!0,{},d,d.options),d.$orig=i,l.src=o.opts.src||d.src||i.attr("href"),l.type||l.src||(l.type="inline",l.src=e)):l={type:"html",src:e+""},l.opts=n.extend(!0,{},o.opts,d),n.isArray(d.buttons)&&(l.opts.buttons=d.buttons),n.fancybox.isMobile&&l.opts.mobile&&(l.opts=h(l.opts,l.opts.mobile)),a=l.type||l.opts.type,r=l.src||"",!a&&r&&((s=r.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))?(a="video",l.opts.video.format||(l.opts.video.format="video/"+("ogv"===s[1]?"ogg":s[1]))):r.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?a="image":r.match(/\.(pdf)((\?|#).*)?$/i)?(a="iframe",l=n.extend(!0,l,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===r.charAt(0)&&(a="inline")),a?l.type=a:o.trigger("objectNeedsType",l),l.contentType||(l.contentType=n.inArray(l.type,["html","inline","ajax"])>-1?"html":l.type),l.index=o.group.length,"auto"==l.opts.smallBtn&&(l.opts.smallBtn=n.inArray(l.type,["html","inline","ajax"])>-1),"auto"===l.opts.toolbar&&(l.opts.toolbar=!l.opts.smallBtn),l.$thumb=l.opts.$thumb||null,l.opts.$trigger&&l.index===o.opts.index&&(l.$thumb=l.opts.$trigger.find("img:first"),l.$thumb.length&&(l.opts.$orig=l.opts.$trigger)),l.$thumb&&l.$thumb.length||!l.opts.$orig||(l.$thumb=l.opts.$orig.find("img:first")),l.$thumb&&!l.$thumb.length&&(l.$thumb=null),l.thumb=l.opts.thumb||(l.$thumb?l.$thumb[0].src:null),"function"===n.type(l.opts.caption)&&(l.opts.caption=l.opts.caption.apply(e,[o,l])),"function"===n.type(o.opts.caption)&&(l.opts.caption=o.opts.caption.apply(e,[o,l])),l.opts.caption instanceof n||(l.opts.caption=void 0===l.opts.caption?"":l.opts.caption+""),"ajax"===l.type&&(c=r.split(/\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.filter=c.shift())),l.opts.modal&&(l.opts=n.extend(!0,l.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),o.group.push(l)}),Object.keys(o.slides).length&&(o.updateControls(),(e=o.Thumbs)&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on("click.fb","[data-fancybox-zoom]",function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on("keydown.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null,i=o.current,a=t.keyCode||t.which;if(9==a)return void(i.opts.trapFocus&&e.focus(t));if(!(!i.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is("input,textarea,video,audio")))return 8===a||27===a?(t.preventDefault(),void e.close(t)):37===a||38===a?(t.preventDefault(),void e.previous()):39===a||40===a?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,a)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){++e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var o,i,a,s,r,c,l,d,u,f=this,h=f.group.length;if(!(f.isDragging||f.isClosing||f.isAnimating&&f.firstRun)){if(t=parseInt(t,10),!(a=f.current?f.current.opts.loop:f.opts.loop)&&(t<0||t>=h))return!1;if(o=f.firstRun=!Object.keys(f.slides).length,r=f.current,f.prevIndex=f.currIndex,f.prevPos=f.currPos,s=f.createSlide(t),h>1&&((a||s.index0)&&f.createSlide(t-1)),f.current=s,f.currIndex=s.index,f.currPos=s.pos,f.trigger("beforeShow",o),f.updateControls(),s.forcedDuration=void 0,n.isNumeric(e)?s.forcedDuration=e:e=s.opts[o?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=f.isMoved(s),s.$slide.addClass("fancybox-slide--current"),o)return s.opts.animationEffect&&e&&f.$refs.container.css("transition-duration",e+"ms"),f.$refs.container.addClass("fancybox-is-open").trigger("focus"),f.loadSlide(s),void f.preload("image");c=n.fancybox.getTranslate(r.$slide),l=n.fancybox.getTranslate(f.$refs.stage),n.each(f.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),r.pos!==s.pos&&(r.isComplete=!1),r.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(u=c.left-(r.pos*c.width+r.pos*r.opts.gutter),n.each(f.slides,function(t,o){o.$slide.removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")});var i=o.pos*c.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:i-l.left+u}),o.pos!==s.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>s.pos?"next":"previous")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-s.pos)*c.width+(o.pos-s.pos)*o.opts.gutter},e,function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===f.currPos&&f.complete()})})):e&&s.opts.transitionEffect&&(d="fancybox-animated fancybox-fx-"+s.opts.transitionEffect,r.$slide.addClass("fancybox-slide--"+(r.pos>s.pos?"next":"previous")),n.fancybox.animate(r.$slide,d,e,function(){r.$slide.removeClass(d).removeClass("fancybox-slide--next fancybox-slide--previous")},!1)),s.isLoaded?f.revealContent(s):f.loadSlide(s),f.preload("image")}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('

').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,o){var i,a,s,r,c,l=this,d=l.current,u=d.$content,f=n.fancybox.getTranslate(d.$slide).width,p=n.fancybox.getTranslate(d.$slide).height,h=d.width,g=d.height;l.isAnimating||l.isMoved()||!u||"image"!=d.type||!d.isLoaded||d.hasError||(l.isAnimating=!0,n.fancybox.stop(u),t=void 0===t?.5*f:t,e=void 0===e?.5*p:e,i=n.fancybox.getTranslate(u),i.top-=n.fancybox.getTranslate(d.$slide).top,i.left-=n.fancybox.getTranslate(d.$slide).left,r=h/i.width,c=g/i.height,a=.5*f-.5*h,s=.5*p-.5*g,h>f&&(a=i.left*r-(t*r-t),a>0&&(a=0),ap&&(s=i.top*c-(e*c-e),s>0&&(s=0),se-.5&&(l=e),d>o-.5&&(d=o),"image"===t.type?(u.top=Math.floor(.5*(o-d))+parseFloat(c.css("paddingTop")),u.left=Math.floor(.5*(e-l))+parseFloat(c.css("paddingLeft"))):"video"===t.contentType&&(a=t.opts.width&&t.opts.height?l/d:t.opts.ratio||16/9,d>l/a?d=l/a:l>d*a&&(l=d*a)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,i=t&&t.$content,a=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),i&&(a||s||"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,o=e.current,i=o.$slide;!e.isClosing&&o&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},void 0===t?0:t,function(){i.css({transform:"",opacity:""}),o.isComplete||e.complete()},!1))},isMoved:function(t){var e,o,i=t||this.current;return!!i&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(i.$slide),!i.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,i,a=this,s=a.current,r=a.$refs.container;s&&!a.isClosing&&a.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),o=a.canPan(t,e),i=!!o||a.isZoomable(),r.toggleClass("fancybox-is-zoomable",i),n("[data-fancybox-zoom]").prop("disabled",!i),o?r.addClass("fancybox-can-pan"):i&&("zoom"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical||a.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if((t=e.getFitPos(n))&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var o=this,i=!1,a=o.current,s=a.$content;return void 0!==t&&void 0!==e?i=t1.5||Math.abs(a.height-s.height)>1.5)),s},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,!1===a.trigger("beforeLoad",t))return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":a.setImage(t);break;case"iframe":a.setIframe(t);break;case"html":a.setContent(t,t.src||t.content);break;case"video":a.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat||t.opts.video.format||"").replace("{{poster}}",t.thumb||""));break;case"inline":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case"ajax":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&a.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&a.setError(t)}})),o.one("onReset",function(){i.abort()});break;default:a.setError(t)}return!0}},setImage:function(t){var o,i=this;setTimeout(function(){var e=t.$image;i.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||i.showLoading(t)},50),i.checkSrcset(t),t.$content=n('

').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),!1!==t.opts.preload&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement("img"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){i.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),i.setBigImage(t)},checkSrcset:function(e){var n,o,i,a,s=e.opts.srcset||e.opts.image.srcset;if(s){i=t.devicePixelRatio||1,a=t.innerWidth*i,o=s.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);if(0===n)return e.url=t;o&&(e.value=o,e.postfix=t[t.length-1])}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r=a||"x"===c.postfix&&c.value>=i){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,i=e.createElement("img"),a=n(i);t.$image=a.one("error",function(){o.setError(t)}).one("load",function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&(e=t.opts.sizes,e&&"auto"!==e||(e=(t.width/t.height>1&&s.width()/s.height()>1?"100":Math.round(t.width/t.height*100))+"vw"),a.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(i.complete||"complete"==i.readyState)&&a.naturalWidth&&a.naturalHeight?a.trigger("load"):i.error&&a.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),i=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),i>0&&(t.width=Math.floor(i*e/n),t.height=i)},setIframe:function(t){var e,o=this,i=t.opts.iframe,a=t.$slide;t.$content=n('

').css(i.css).appendTo(a),a.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(o.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),o.afterLoad(t)}),a.on("refresh.fb",function(){var n,o,s=t.$content,r=i.css.width,c=i.css.height;if(1===e[0].isReady){try{n=e.contents(),o=n.find("body")}catch(t){}o&&o.length&&o.children().length&&(a.css("overflow","visible"),s.css({width:"100%","max-width":"100%",height:"9999px"}),void 0===r&&(r=Math.ceil(Math.max(o[0].clientWidth,o.outerWidth(!0)))),s.css("width",r||"").css("max-width",""),void 0===c&&(c=Math.ceil(Math.max(o[0].clientHeight,o.outerHeight(!0)))),s.css("height",c||""),a.css("overflow","auto")),s.removeClass("fancybox-is-hidden")}})):o.afterLoad(t),e.attr("src",t.src),a.one("onReset",function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass("fancybox-content")||e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("

").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("

").append(n.trim(e)).contents()),t.opts.filter&&(e=n("

").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("

"),t.contentType="video",t.opts.width=t.opts.width||n(e).attr("width"),t.opts.height=t.opts.height||n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner("

").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('

').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass("fancybox-caption--separate",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css("padding-bottom",r||""))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css("margin-bottom",""),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style["padding-bottom"],i=s.$slide.css("padding-bottom"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css("padding-bottom",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css("padding-bottom",o))),s.$content.css("margin-bottom",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?"animationEffect":"transitionEffect"],i=t.opts[s.firstRun?"animationDuration":"transitionDuration"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),"zoom"===e&&(t.pos===s.currPos&&i&&"image"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e="fade"),"zoom"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,"auto"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o="fancybox-slide--"+(t.pos>=s.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,r.addClass(o).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),p(r),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,"fancybox-slide--current",i,function(){r.removeClass(o).css({transform:"",opacity:""}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass("fancybox-is-hidden"),u||!d||"image"!==t.type||t.hasError||t.$content.hide().fadeIn("fast"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css("border-top-width")||0),i=parseFloat(c.css("border-right-width")||0),a=parseFloat(c.css("border-bottom-width")||0),s=parseFloat(c.css("border-left-width")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),p(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",function(){this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&"html"===o.contentType&&(t=o.$content.find("input[autofocus]:enabled:visible:first"),t.length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","video","audio","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find("*:visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible"),i=i.filter(r).filter(function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger("focus")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger("beforeClose",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger("onReset").remove(),i&&u.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",i+"ms"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),"zoom"!==o||a&&i&&"image"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o="fade"),"zoom"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,"auto"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0), n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;"afterClose"!==t&&a.$refs?a.$refs.container.trigger(t+".fb",i):r.trigger(t+".fb",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find("[data-fancybox-count]").html(t.group.length),a.find("[data-fancybox-index]").html(i+1),a.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&i<=0),a.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&i>=t.group.length-1),"image"===o.type?a.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=this,n=["infobar","toolbar","nav"];!t&&e.current.opts.preventCaptionOverlap||n.push("caption"),this.$refs.container.removeClass(n.map(function(t){return"fancybox-show-"+t}).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.6",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add("body").off("click.fb-start","**")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))})},setTranslate:function(t,e){var n="",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+"px, "+(void 0===e.top?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=" scale("+e.scaleX+", "+e.scaleY+")":void 0!==e.scaleX&&(n+=" scaleX("+e.scaleX+")"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&"z-index"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css("transition-duration",""),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css("transition-duration",o+"ms"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(f),t.off(f).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},i):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},i),this},r.on("click.fb-start","[data-fancybox]",i),r.on("click.fb-start","[data-fancybox-trigger]",function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")||0).trigger("click.fb-start",{$trigger:n(this)})}),function(){var t=null;r.on("mousedown mouseup focus blur",".fancybox-button",function(e){switch(e.type){case"mousedown":t=n(this);break;case"mouseup":t=null;break;case"focusin":n(".fancybox-button").removeClass("fancybox-focus"),n(this).is(t)||n(this).is("[disabled]")||n(this).addClass("fancybox-focus");break;case"focusout":n(".fancybox-button").removeClass("fancybox-focus")}})}()}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"https://www.youtube-nocookie.com/embed/$4",thumb:"https://img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||"",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],"?"==d[0]&&(d=d.substring(1)),d=d.split("&");for(var i=0;i1&&("youtube"===n.contentSource||"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,i=o.length;ee.clientHeight,a=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-stage")||t.is("body"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};d.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h="touchstart"==o.type;if(h&&i.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(i,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(i,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(".fancybox-caption").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass("fancybox-is-grabbing")),2===i.startPoints.length&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener("scroll",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging||!1===s.opts.vertical||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&aa?(t=t>0?0:t,t=ts?(e=e>0?0:e,e=e1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||"x"!=t&&"y"!=t||o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),rs.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(i.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(i.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is("img")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f("dblclick"+o)}else i.tapX=d,i.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f("click"+o)},500):f("click"+o);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:''},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('

').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))})}e(t).on({"onInit.fb":function(t,e){var i;if(!n)return void e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()},"afterKeydown.fb":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:''},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var i=0,a=n.length;i1));i++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('

').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on("click","a",function(){i.jumpTo(e(this).attr("data-index"))})),o.$list||(o.$list=e('

').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||"image"!==n.type||(t=n.src),s.push('")}),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+o.instance.current.index+'"]').addClass("fancybox-thumbs-active"),n=e.position(),"y"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===o.opts.axis&&(n.lefta.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},"beforeShow.fb":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:''},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc||e.src)||window.location}, tpl:''}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&("function"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===a.type?encodeURIComponent(a.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,o),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one("beforeClose.fb",function(){t.close(null,0)}),e.$content.find(".fancybox-share__button").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join("-");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,""!==(n=e.hash||(e.$orig?e.$orig.data("fancybox")||e.$orig.data("fancybox-trigger"):""))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+"").replace(/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({"onInit.fb":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?"-"+(i.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},"beforeClose.fb":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),function(t,o){var i=n(o).data("FancyBox");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+"-"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):""!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))})}})}(document,jQuery); // source --> https://czyszczenieimonitoringkanalizacji.pl/wp-content/themes/pure/framework/common/js/global.js?ver=5.5.11 // EXPAND ELEMENT BY BUTTON WITCH CLASS .expand and data='.elementToExpand' function expand( button ){ var item = button.attr('data-class') if( jQuery(item).hasClass('expanded') ){ if( jQuery(button).hasClass('withAnimate') ) jQuery(item).slideUp(); jQuery(item).removeClass('expanded') }else{ if( jQuery(button).hasClass('withAnimate') ) jQuery(item).slideDown(); jQuery(item).addClass('expanded'); } } // check preload img with class .preload function preloadimg(){ jQuery.each(jQuery('.img.preload'), function(){ var img = jQuery(this); if( img.attr('data-preload') != '' ){ preloadImage( img.attr('data-preload'), function(){ img.attr('data-preload', '').addClass('loaded'); } ) } }); } // preload image first function preloadImage(url, callback) { var img=new Image(); img.src=url; img.onload = callback; } // smooth scroll to item function scrollto( item ){ if( jQuery(item).length ) jQuery('html, body').animate({ scrollTop: parseInt(jQuery(item).offset().top)-60 }, 1000); } // detect scroll function scroll_detect(){ if( jQuery(window).scrollTop() > 50 ) jQuery('body').addClass('scroll'); else jQuery('body').removeClass('scroll'); } // make gutenberg gallery Fancy ! function gutenberg_gallery(){ if( jQuery().fancybox ){ jQuery('.wp-block-gallery a').attr('data-fancybox','gallery'); jQuery('.wp-block-gallery a').fancybox({ }); } } // select isotope slug function button_isotope(button){ var slug = button.attr('data-slug'); jQuery('.button_isotope').removeClass('selected'); button.addClass('selected'); if( jQuery('.isotope') ){ jQuery('.isotope').isotope({ filter: slug }); } } function javaonsee(){ jQuery('.javaonsee').each(function(i,v){ if( !jQuery(v).hasClass('see') ){ var offset = jQuery(v).offset(); if( offset.top < jQuery(window).scrollTop()+jQuery(window).height()-100 ){ jQuery(v).addClass('see'); } } }); } function text_autoswipe( item ){ jQuery(item+' .text-autoswipe-load_more').on('click', function(){ console.log( jQuery(item+' .text-autoswipe-content').height() ); jQuery(item).animate({ height : jQuery(item+' .text-autoswipe-content').height()+'px'}, 250, function(){ jQuery(item).height('auto'); } ); jQuery(item+' .text-autoswipe-load_more').slideUp(); jQuery(item+' .text-autoswipe-load_less').slideDown(); }) jQuery(item+' .text-autoswipe-load_less').on('click', function(){ jQuery(item).animate({height:jQuery(item).attr('data-height')+'px'}); jQuery(item+' .text-autoswipe-load_more').slideDown(); jQuery(item+' .text-autoswipe-load_less').slideUp(); }) } // function pure_woo_perpage(item){ // item.parent().find('button[type=submit]').trigger('click'); // } jQuery(document).ready(function(){ if( !jQuery('body').hasClass('wp-admin') ){ jQuery('.expand').on('click', function(){ expand( jQuery(this) ); }); jQuery('.scrollto').on('click', function(){ scrollto( jQuery(this).attr("data") ); }); jQuery('.button_isotope').on('click', function(){ button_isotope( jQuery(this) ); }); jQuery(window).on('scroll', function(){ scroll_detect(); }); // WOOCOMMERCE CONFLICT // jQuery(document).on('click', 'a[href^="#"]', function (event) { // console.log( window.location.protocol+'//'+window.location.hostname+'/'+jQuery(this).attr('href') ); // event.preventDefault(); // if( !jQuery(jQuery(this).attr('href')).length ){ // self.location = window.location.protocol+'//'+window.location.hostname+'/'+jQuery(this).attr('href'); // } // scrollto( jQuery(this).attr('href') ); // }); // END WOOCOMMERCE CONFLICT //isotope hash get var res = window.location.hash.substr(1).toLowerCase(); if( jQuery('.button_'+res.replace(/%20/g, '_')).length ) jQuery('.button_'+res).trigger('click'); // ie9 ve ie7 return true but never fire, lets remove ie less then 10 if(("onhashchange" in window) && navigator.userAgent.toLowerCase().indexOf('msie') == -1){ // event supported? window.onhashchange = function(){ var res = window.location.hash.substr(1).toLowerCase(); if( jQuery('.button_'+res.replace(/%20/g, '_')).length ) jQuery('.button_'+res).trigger('click'); } } else{ // event not supported: var storedhash = window.location.hash; window.setInterval(function(){ if(window.location.hash != storedhash){ var res = window.location.hash.substr(1).toLowerCase(); if( jQuery('.button_'+res.replace(/%20/g, '_')).length ) jQuery('.button_'+res).trigger('click'); } }, 100); } scroll_detect(); preloadimg(); gutenberg_gallery(); if( jQuery().YTPlayer ) jQuery(".ytplayer").YTPlayer(); if( jQuery().vimeo_player ) jQuery(".viplayer").vimeo_player(); javaonsee(); jQuery(window).on('scroll', function(){ javaonsee(); }); } // jQuery(document).on('DOMSubtreeModified', function(){ // preloadimg(); // }); var observer = new MutationObserver(function(mutations) { if (jQuery('.img.preload:not(.loaded)').length) { preloadimg(); } }); observer.observe(document.body, { childList: true, subtree: true }); // WOOCOMMERCE // jQuery('select[name=pure_woo_perpage]').on('change', function(){ // pure_woo_perpage( jQuery(this) ); // }); // jQuery().fancybox({ // selector : '#woocommerce .product .woocommerce-product-gallery a', // loop:true // }); // jQuery( document.body ).on( 'added_to_cart', function(){ // var data = { // 'action' : 'pure_woo_refresh_cart' // }; // jQuery.post(settings.ajaxurl, data, function(response) { // console.log( response ); // }); // }); }); // source --> https://czyszczenieimonitoringkanalizacji.pl/wp-content/themes/pure/custom/script.js?ver=5.5.11 // // ALL CUSTOM JAVASCRIPT KEEP HERE // UPDATE WILL NOT DELETE OR MODIFY THIS FILE // jQuery(document).ready(function(){ });

{{SHARE}}